Seznam harmonizovaných klasifikací chemických látek
Tabulka 3.1 - část 1 - Seznam harmonizovaných klasifikací a označení nebezpečných látek
|
Indexové číslo |
Mezinárodní identifikace chemických látek |
Číslo ES |
Číslo CAS |
Klasifikace |
Označení |
Specifické koncent.limity, multiplikačnífaktory
|
Pozn. |
|||
|
Kódy tříd a kategorií nebezpečnosti |
Kódy standardních vět o nebezpečnosti |
Kódy výstražných symbolůa signálních slov |
Kódy standardních vět o nebezpečnosti |
Kódy doplň.standardních vět o nebezpečnosti |
||||||
|
001-001-00-9 |
hydrogen |
215-605-7 |
1333-74-0 |
Flam. Gas 1 Press. Gas |
H220 |
GHS02 GHS04 Dgr |
H220 |
|
|
U
|
|
001-002-00-4 |
aluminium lithium hydride |
240-877-9 |
16853-85-3 |
Water-react. 1 Skin Corr. 1A |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
|
|
|
|
001-003-00-X |
sodium hydride |
231-587-3 |
7646-69-7 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
773-243-643 |
|
|
001-004-00-5 |
calcium hydride |
232-189-2 |
7789-78-8 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
|
|
003-001-00-4 |
lithium |
231-102-5 |
7439-93-2 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
003-002-00-X |
n-hexyllithium |
404-950-0 |
21369-64-2 |
Water-react. 1 Pyr. Sol. 1 Skin Corr. 1A |
H260 H250 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014
|
|
|
|
003-003-00-5 |
(2-methylpropyl)lithium; isobutyllithium |
440-620-2 |
920-36-5 |
Water-react. 1 Pyr. Liq. 1 Skin Corr. 1A STOT SE 3 Aquatic Acute 1 Aquatic Chronic 1 |
H260 H250 H314 H336 H400 H410 |
GHS02 GHS05 GHS07 GHS09 Dgr |
H260 H250 H314 H336 H410 |
EUH014
|
|
|
|
004-001-00-7 |
beryllium |
231-150-7 |
7440-41-7 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
|
|
|
|
004-002-00-2 |
beryllium compounds with the exception of aluminium beryllium silicates, and with those specified elsewhere in this Annex |
- |
- |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 H411 |
|
|
A
|
|
004-003-00-8 |
beryllium oxide |
215-133-1 |
1304-56-9 |
Carc. 1B Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
GHS06 GHS08 Dgr |
H350i H330 H301 H372 ** H319 H335 H315 H317 |
|
|
|
|
005-001-00-X |
boron trifluoride |
231-569-5 |
7637-07-2 |
Press. Gas Acute Tox. 2 * Skin Corr. 1A |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
EUH014
|
|
U
|
|
005-002-00-5 |
boron trichloride |
233-658-4 |
10294-34-5 |
Press. Gas Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1B |
H330 H300 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014
|
|
U
|
|
005-003-00-0 |
boron tribromide |
233-657-9 |
10294-33-4 |
Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A |
H330 H300 H314 |
GHS06 GHS05 Dgr |
H330 H300 H314 |
EUH014
|
|
|
|
005-004-00-6 |
trialkylboranes |
- |
- |
Pyr. Sol. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
|
|
A
|
|
005-004-01-3 |
trialkylboranes, liquid |
- |
- |
Pyr. Liq. 1 Skin Corr. 1B |
H250 H314 |
GHS02 GHS05 Dgr |
H250 H314 |
|
|
A
|
|
005-005-00-1 |
trimethyl borate |
204-468-9 |
121-43-7 |
Flam. Liq. 3 Acute Tox. 4 * |
H226 H312 |
GHS02 GHS07 Wng |
H226 H312 |
|
|
|
|
005-006-00-7 |
dibutyltin hydrogen borate |
401-040-5 |
75113-37-0 |
Repr. 1B Muta. 2 STOT RE 1 Acute Tox. 4 * Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H360FD H341 H372** H312 H302 H318 H317 H400 H410 |
GHS05 GHS08 GHS07 GHS09 Dgr |
H360FD H341 H372** H312 H302 H318 H317 H410 |
|
|
758/2013 |
|
005-007-00-2 |
boric acid; [1] boric acid; [2] |
233-139-2 [1] 234-343-4 [2] |
10043-35-3 [1] 11113-50-1 [2] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr. 1B; H360FD: C ≥ 5,5 % |
758/2013 |
|
005-008-00-8 |
diboron trioxide; boric oxide |
215-125-8 |
1303-86-2 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr. 1B; H360FD: C ≥ 3,1 % |
|
|
005-009-00-3 |
tetrabutylammonium butyltriphenylborate |
418-080-4 |
120307-06-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
005-010-00-9 |
N,N-dimethylanilinium tetrakis(pentafluorophenyl)borate |
422-050-6 |
118612-00-3 |
Carc. 2 Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H351 H302 H315 H318 |
GHS08 GHS05 GHS07 Dgr |
H351 H302 H315 H318 |
|
|
|
|
005-011-00-4 |
disodium tetraborate, anhydrous; boric acid, disodium salt; [1] tetraboron disodium heptaoxide, hydrate; [2] orthoboric acid, sodium salt [3] |
215-540-4 [1] 235-541-3 [2] 237-560-2 [3] |
1330-43-4 [1] 12267-73-1 [2] 13840-56-7 [3] |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr. 1B; H360FD: C ≥ 4,5 % |
|
|
005-011-01-1 |
disodium tetraborate decahydrate; borax decahydrate |
215-540-4 |
1303-96-4 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr. 1B; H360FD: C ≥ 8,5 % |
|
|
005-011-02-9 |
disodium tetraborate pentahydrate; borax pentahydrate |
215-540-4 |
12179-04-3 |
Repr. 1B |
H360FD |
GHS08 Dgr |
H360FD |
|
Repr. 1B; H360FD: C ≥ 6,5 % |
|
|
005-012-00-X |
diethyl{}{4-[1,5,5-tris(4-diethylaminophenyl)penta-2,4-dienylidene]cyclohexa-2,5-dienylidene}}ammonium butyltriphenylborate |
418-070-1 |
141714-54-7 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
005-013-00-5 |
diethylmethoxyborane |
425-380-9 |
7397-46-8 |
Pyr. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 4 |
H250 H332 H312 H302 H373** H314 H317 H413 |
GHS02 GHS05 GHS08 GHS07 Dgr |
H250 H332 H312 H302 H373** H314 H317 H413 |
|
|
|
|
005-014-00-0 |
4-formylphenylboronic acid |
438-670-5 |
87199-17-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
005-015-00-6 |
1-chloromethyl-4-fluoro-1,4-diazoniabicyclo[2.2.2]octane bis(tetrafluoroborate) |
414-380-4 |
140681-55-6 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H302 H318 H317 H412 |
GHS05 GHS07 Dgr |
H302 H318 H317 H412 |
|
|
|
|
005-016-00-1 |
tetrabutylammonium butyl tris-(4-tert-butylphenyl)borate |
431-370-5 |
- |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
005-017-00-7 |
sodium perborate; [1] sodium peroxometaborate; [2] sodium peroxoborate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 231-556-4 [2] |
15120-21-5 [1] 7632-04-4 [2] |
Ox. Sol. 2 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H360Df H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
758/2013 |
|
005-017-01-4 |
sodium perborate; [1] sodium peroxometaborate; [2] sodium peroxoborate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 231-556-4 [2] |
15120-21-5 [1] 7632-04-4 [2] |
Ox. Sol. 2 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H360Df H331 H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
758/2013 |
|
005-018-00-2 |
perboric acid (H3BO2(O2)), monosodium salt trihydrate; [1] perboric acid, sodium salt, tetrahydrate; [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate [3] sodium peroxoborate hexahydrate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
239-172-9 [1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9 [1] 37244-98-7 [2] 10486-00-7 [3] |
Repr. 1B STOT SE 3 Eye Dam. 1 |
H360Df H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H335 H318 |
|
Repr. 1B; H360Df: C ≥ 14 % Repr. 1B; H360D: 10 % ≤ C < 14 % Eye Dam. 1; H318: C ≥ 36 % Eye Irrit. 2; H319: 22 % ≤ C < 36 % |
758/2013 |
|
005-018-01-X |
perboric acid (H3BO2(O2)), monosodium salt, trihydrate; [1] perboric acid, sodium salt, tetrahydrate; [2] perboric acid (HBO(O2)), sodium salt, tetrahydrate [3] |
239-172-9 [1] 234-390-0 [2] 231-556-4 [3] |
13517-20-9 [1] 37244-98-7 [2] 10486-00-7 [3] |
Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H360Df H332 H335 H318 |
GHS05 GHS08 GHS07 Dgr |
H360Df H332 H335 H318 |
|
C ≥ 14 %: Repr. 1B; H360 Df 10 % ≤ C < 14 %: Repr. 1B; H360D C ≥ 36 %: Eye Dam. 1; H318 22 % ≤ C < 36 %: Eye Irrit. 2; H319 |
|
|
005-019-00-8 |
perboric acid, sodium salt; [1] perboric acid, sodium salt, monohydrate; [2] perboric acid (HBO(O2)), sodium salt, monohydrate; [3] sodium peroxoborate; [containing < 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
234-390-0 [1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9 [1] 12040-72-1 [2] 10332-33-9 [3] |
Ox. Sol. 3 Repr. 1B Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H302 H335 H318 |
GHS03 GHS05 GHS08 GHS07 Dgr |
H272 H360Df H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
758/2013 |
|
005-019-01-5 |
perboric acid, sodium salt; [1] perboric acid, sodium salt, monohydrate; [2] perboric acid (HBO(O2)), sodium salt, monohydrate [3] sodium peroxoborate; [containing ≥ 0,1 % (w/w) of particles with an aerodynamic diameter of below 50 μm] |
234-390-0 [1] 234-390-0 [2] 231-556-4 [3] |
11138-47-9 [1] 12040-72-1 [2] 10332-33-9 [3] |
Ox. Sol. 3 Repr. 1B Acute Tox. 3 * Acute Tox. 4 * STOT SE 3 Eye Dam. 1 |
H272 H360Df H331 H302 H335 H318 |
GHS03 GHS06 GHS05 GHS08 Dgr |
H272 H360Df H331 H302 H335 H318 |
|
Repr. 1B; H360Df: C ≥ 9 % Repr. 1B; H360D: 6,5 % ≤ C < 9 % Eye Dam. 1; H318: C ≥ 22 % Eye Irrit. 2; H319: 14 % ≤ C < 22 % |
758/2013 |
|
006-001-00-2 |
carbon monoxide |
211-128-3 |
630-08-0 |
Flam. Gas 1 Press. Gas Repr. 1A Acute Tox. 3 * STOT RE 1 |
H220 H360D *** H331 H372 ** |
GHS02 GHS04 GHS06 GHS08 Dgr |
H220 H360D *** H331 H372 ** |
|
|
U
|
|
006-002-00-8 |
phosgene; carbonyl chloride |
200-870-3 |
75-44-5 |
Press. Gas Acute Tox. 2 * Skin Corr. 1B |
H330 H314 |
GHS04 GHS06 GHS05 Dgr |
H330 H314 |
|
|
U
|
|
006-003-00-3 |
carbon disulphide |
200-843-6 |
75-15-0 |
Flam. Liq. 2 Repr. 2 STOT RE 1 Eye Irrit. 2 Skin Irrit. 2 |
H225 H361fd H372 ** H319 H315 |
GHS02 GHS08 GHS07 Dgr |
H225 H361fd H372 ** H319 H315 |
|
Repr. 2; H361fd: C ≥ 1 % STOT RE 1; H372: C ≥ 1 % STOT RE 2; H373: 0,2 % ≤C < 1 % |
|
|
006-004-00-9 |
calcium carbide |
200-848-3 |
75-20-7 |
Water-react. 1 |
H260 |
GHS02 Dgr |
H260 |
|
|
T
|
|
006-005-00-4 |
thiram (ISO); tetramethylthiuram disulphide |
205-286-2 |
137-26-8 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H373 ** H319 H315 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H332 H302 H373 ** H319 H315 H317 H410 |
|
M = 10 |
|
|
006-006-00-X |
hydrogen cyanide; hydrocyanic acid |
200-821-6 |
74-90-8 |
Flam. Liq. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H224 H330 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H224 H330 H410 |
|
|
|
|
006-006-01-7 |
hydrogen cyanide ...%; hydrocyanic acid ...% |
200-821-6 |
74-90-8 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
|
B
|
|
006-007-00-5 |
salts of hydrogen cyanide with the exception of complex cyanides such as ferrocyanides, ferricyanides and mercuric oxycyanide and those specified elsewhere in this Annex |
- |
- |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
EUH032
|
|
A
|
|
006-008-00-0 |
antu (ISO); 1-(1-naphthyl)-2-thiourea |
201-706-3 |
86-88-4 |
Acute Tox. 2 * Carc. 2 |
H300 H351 |
GHS06 GHS08 Dgr |
H300 H351 |
|
|
|
|
006-009-00-6 |
1-isopropyl-3-methylpyrazol-5-yl dimethylcarbamate; Isolan |
204-318-2 |
119-38-0 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
006-010-00-1 |
5,5-dimethyl-3-oxocyclohex-1-enyl dimethylcarbamate 5,5-dimethyldihydroresorcinol dimethylcarbamate; Dimetan |
204-525-8 |
122-15-6 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
006-011-00-7 |
carbaryl (ISO); 1-naphthyl methylcarbamate |
200-555-0 |
63-25-2 |
Carc. 2 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H351 H332 H302 H400 |
GHS08 GHS07 GHS09 Wng |
H351 H332 H302 H400 |
|
M=100 |
|
|
006-012-00-2 |
ziram (ISO); zinc bis dimethyldithiocarbamate |
205-288-3 |
137-30-4 |
Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 * STOT SE 3 Eye Dam. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H302 H373 ** H335 H318 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H302 H373 ** H335 H318 H317 H410 |
|
M = 100 |
|
|
006-013-00-8 |
metam-sodium (ISO); sodium methyldithiocarbamate |
205-293-0 |
137-42-8 |
Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H314 H317 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H302 H314 H317 H410 |
EUH031
|
|
|
|
006-014-00-3 |
nabam (ISO); disodium ethylenebis(N,N'-dithiocarbamate) |
205-547-0 |
142-59-6 |
Acute Tox. 4 * STOT SE 3 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H335 H317 H410 |
GHS07 GHS09 Wng |
H302 H335 H317 H410 |
|
|
|
|
006-015-00-9 |
diuron (ISO); 3-(3,4-dichlorophenyl)-1,1- dimethylurea |
206-354-4 |
330-54-1 |
Carc. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H373** H410 |
|
M = 10 |
758/2013 |
|
006-016-00-4 |
propoxur (ISO); 2-isopropyloxyphenyl N-methylcarbamate; 2-isopropoxyphenyl methylcarbamate |
204-043-8 |
114-26-1 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
006-017-00-X |
aldicarb (ISO); 2-methyl-2-(methylthio)propanal-O-(N-methylcarbamoyl)oxime |
204-123-2 |
116-06-3 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
|
|
|
|
006-018-00-5 |
aminocarb (ISO); 4-dimethylamino-3-tolyl methylcarbamate |
217-990-7 |
2032-59-9 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
006-019-00-0 |
di-allate (ISO); S-(2,3-dichloroallyl)-N,N-diisopropylthiocarbamate |
218-961-1 |
2303-16-4 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
006-020-00-6 |
barban (ISO); 4-chlorbut-2-ynyl N-(3-chlorophenyl)carbamate |
202-930-4 |
101-27-9 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
006-021-00-1 |
linuron (ISO); 3-(3,4-dichlorophenyl)-1-methoxy-1-methylurea |
206-356-5 |
330-55-2 |
Repr. 1B Carc. 2 Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H351 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H351 H302 H373 ** H410 |
|
|
|
|
006-022-00-7 |
decarbofuran (ISO); 2,3-dihydro-2-methylbenzofuran-7-yl methylcarbamate |
- |
1563-67-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
006-023-00-2 |
mercaptodimethur (ISO); methiocarb (ISO); 3,5-dimethyl-4-methylthiophenyl N-methylcarbamate |
217-991-2 |
2032-65-7 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
006-024-00-8 |
proxan-sodium (ISO); sodium O-isopropyldithiocarbonate |
205-443-5 |
140-93-2 |
Acute Tox. 4 * Skin Irrit. 2 Aquatic Chronic 2 |
H302 H315 H411 |
GHS07 GHS09 Wng |
H302 H315 H411 |
|
|
|
|
006-025-00-3 |
allethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1RS,3RS;1RS,3SR)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; bioallethrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; [1] S-bioallethrin; (S)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate; [2] esbiothrin; (RS)-3-allyl-2-methyl-4-oxocyclopent-2-enyl (1R,3R)-2,2-dimethyl-3-(2-methylprop-1-enyl)cyclopropanecarboxylate [3] |
209-542-4 [1] 249-013-5 [2] 249-013-5 [3] |
584-79-2 [1] 28434-00-6 [2] 84030-86-4 [3] |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
|
C
|
|
006-026-00-9 |
carbofuran (ISO); 2,3-dihydro-2,2-dimethylbenzofuran-7-yl N-methylcarbamate |
216-353-0 |
1563-66-2 |
Acute Tox. 2 * Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H410 |
|
|
|
|
006-028-00-X |
dinobuton (ISO); 2-(1-methylpropyl)-4,6-dinitrophenyl isopropyl carbonate |
213-546-1 |
973-21-7 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
006-029-00-5 |
dioxacarb (ISO); 2-(1,3-dioxolan-2-yl)phenyl N-methylcarbamate |
230-253-4 |
6988-21-2 |
Acute Tox. 3 * Aquatic Chronic 2 |
H301 H411 |
GHS06 GHS09 Dgr |
H301 H411 |
|
|
|
|
006-030-00-0 |
EPTC (ISO); S-ethyl dipropylthiocarbamate |
212-073-8 |
759-94-4 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-031-00-6 |
formetanate (ISO); 3-[(EZ)-dimethylaminomethyleneamino]phenyl methylcarbamate |
244-879-0 |
22259-30-9 |
Acute Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
|
|
|
|
006-032-00-1 |
monolinuron (ISO); 3-(4-chlorophenyl)-1-methoxy-1-methylurea |
217-129-5 |
1746-81-2 |
Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H410 |
|
|
|
|
006-033-00-7 |
metoxuron (ISO); 3-(3-chloro-4-methoxyphenyl)-1,1-dimethylurea |
243-433-2 |
19937-59-8 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
006-034-00-2 |
pebulate (ISO); N-butyl-N-ethyl-S-propylthiocarbamate |
214-215-4 |
1114-71-2 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
006-035-00-8 |
pirimicarb (ISO); 5,6-dimethyl-2-dimethylamino-pyrimidin-4-yl N,N-dimethylcarbamate |
245-430-1 |
23103-98-2 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
006-036-00-3 |
benzthiazuron (ISO); 1-benzothiazol-2-yl-3-methylurea |
217-685-9 |
1929-88-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-037-00-9 |
promecarb (ISO); 3-isopropyl-5-methylphenyl N-methylcarbamate |
220-113-0 |
2631-37-0 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
|
|
|
006-038-00-4 |
sulfallate (ISO); 2-chloroallyl N,N-dimethyldithiocarbamate |
202-388-9 |
95-06-7 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
006-039-00-X |
tri-allate (ISO); S-2,3,3-trichloroallyl diisopropylthiocarbamate |
218-962-7 |
2303-17-5 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
|
006-040-00-5 |
3-methylpyrazol-5-yl-dimethylcarbamate; monometilan |
- |
2532-43-6 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
006-041-00-0 |
dimethylcarbamoyl chloride |
201-208-6 |
79-44-7 |
Carc. 1B Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H350 H331 H302 H319 H335 H315 |
GHS06 GHS08 Dgr |
H350 H331 H302 H319 H335 H315 |
|
Carc. 1B; H350: C ≥ 0,001 % |
|
|
006-042-00-6 |
monuron (ISO); 3-(4-chlorophenyl)-1,1-dimethylurea |
205-766-1 |
150-68-5 |
Carc. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H302 H410 |
|
|
|
|
006-043-00-1 |
3-(4-chlorophenyl)-1,1-dimethyluronium trichloroacetate; monuron-TCA |
- |
140-41-0 |
Carc. 2 Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H319 H315 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H351 H319 H315 H410 |
|
|
|
|
006-044-00-7 |
isoproturon (ISO); 3-(4-isopropylphenyl)-1,1-dimethylurea |
251-835-4 |
34123-59-6 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 10 |
|
|
006-045-00-2 |
methomyl (ISO); 1-(methylthio)ethylideneamino N-methylcarbamate |
240-815-0 |
16752-77-5 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H410 |
|
M=100 |
|
|
006-046-00-8 |
bendiocarb (ISO); 2,2-dimethyl-1,3-benzodioxol-4-yl N-methylcarbamate |
245-216-8 |
22781-23-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H410 |
|
|
|
|
006-047-00-3 |
bufencarb (ISO); reaction mass of 3-(1-methylbutyl)phenyl N-methylcarbamate and 3-(1-ethylpropyl)phenyl N-methylcarbamate |
- |
8065-36-9 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
006-048-00-9 |
ethiofencarb (ISO); 2-(ethylthiomethyl)phenyl N-methylcarbamate |
249-981-9 |
29973-13-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
006-049-00-4 |
dixanthogen; O,O-diethyl dithiobis(thioformate) |
207-944-4 |
502-55-6 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-050-00-X |
1,1-dimethyl-3-phenyluronium trichloroacetate; fenuron-TCA |
- |
4482-55-7 |
Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H400 H410 |
GHS07 GHS09 Wng |
H315 H410 |
|
|
|
|
006-051-00-5 |
ferbam (ISO); iron tris(dimethyldithiocarbamate) |
238-484-2 |
14484-64-1 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H410 |
|
|
|
|
006-052-00-0 |
formetanate hydrochloride; 3-(N,N-dimethylaminomethyleneamino)phenyl N-methylcarbamate |
245-656-0 |
23422-53-9 |
Acute Tox. 2 * Acute Tox. 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H317 H410 |
|
|
|
|
006-053-00-6 |
isoprocarb (ISO); 2-isopropylphenyl N-methylcarbamate |
220-114-6 |
2631-40-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
006-054-00-1 |
mexacarbate (ISO); 3,5-dimethyl-4-dimethylaminophenyl N-methylcarbamate |
206-249-3 |
315-18-4 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
006-055-00-7 |
xylylcarb (ISO); 3,4-dimethylphenyl N-methylcarbamate; 3,4-xylyl methylcarbamate; MPMC |
219-364-9 |
2425-10-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
006-056-00-2 |
metolcarb (ISO); m-tolyl methylcarbamate; MTMC |
214-446-0 |
1129-41-5 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
006-057-00-8 |
nitrapyrin (ISO); 2-chloro-6-trichloromethylpyridine |
217-682-2 |
1929-82-4 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
006-058-00-3 |
noruron (ISO); 1,1-dimethyl-3-(perhydro-4,7-methanoinden-5-yl)urea |
- |
2163-79-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-059-00-9 |
oxamyl (ISO); N',N'-dimethylcarbamoyl(methylthio)methylenamine N-methylcarbamate |
245-445-3 |
23135-22-0 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 4 * Aquatic Chronic 2 |
H330 H300 H312 H411 |
GHS06 GHS09 Dgr |
H330 H300 H312 H411 |
|
|
|
|
006-060-00-4 |
oxycarboxin (ISO); 2,3-dihydro-6-methyl-5-(N-phenylcarbamoyl)-1,4-oxothiine 4,4-dioxide |
226-066-2 |
5259-88-1 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
006-061-00-X |
S-ethyl N-(dimethylaminopropyl)thiocarbamatehydrochloride; prothiocarb hydrochloride |
243-193-9 |
19622-19-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
006-062-00-5 |
methyl 3,4-dichlorophenylcarbanilate; SWEP. |
- |
1918-18-9 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-063-00-0 |
thiobencarb (ISO); S-4-chlorobenzyl diethylthiocarbamate |
248-924-5 |
28249-77-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
006-064-00-6 |
thiofanox (ISO); 3,3-dimethyl-1-(methylthio)butanone-O-(N-methylcarbamoyl)oxime |
254-346-4 |
39196-18-4 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
006-065-00-1 |
3-chloro-6-cyano-bicyclo(2,2,1)heptan-2-one-O-(N-methylcarbamoyl)oxime; triamid |
- |
15271-41-7 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Chronic 2 |
H300 H311 H411 |
GHS06 GHS09 Dgr |
H300 H311 H411 |
|
|
|
|
006-066-00-7 |
vernolate (ISO); S-propyl dipropylthiocarbamate |
217-681-7 |
1929-77-7 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
006-067-00-2 |
XMC; 3,5-xylyl methylcarbamate |
- |
2655-14-3 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
006-068-00-8 |
diazomethane |
206-382-7 |
334-88-3 |
Carc. 1B |
H350 |
GHS08 Dgr |
H350 |
|
|
|
|
006-069-00-3 |
thiophanate-methyl (ISO); 1,2-di-(3-methoxycarbonyl-2-thioureido)benzene |
245-740-7 |
23564-05-8 |
Muta. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H332 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H341 H332 H317 H410 |
|
|
|
|
006-070-00-9 |
furmecyclox (ISO); N-cyclohexyl-N-methoxy-2,5-dimethyl-3-furamide |
262-302-0 |
60568-05-0 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
|
|
|
006-071-00-4 |
cyclooct-4-en-1-yl methyl carbonate |
401-620-8 |
87731-18-8 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
006-072-00-X |
prosulfocarb(ISO); S-benzyl N,N-dipropylthiocarbamate |
401-730-6 |
52888-80-9 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
006-073-00-5 |
3-(dimethylamino)propylurea |
401-950-2 |
31506-43-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
006-074-00-0 |
2-(3-(prop-1-en-2-yl)phenyl)prop-2-yl isocyanate |
402-440-2 |
2094-99-7 |
Acute Tox. 2 * Skin Corr. 1B STOT RE 2 * Resp. Sens. 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H314 H373 ** H334 H317 H400 H410 |
GHS06 GHS08 GHS05 GHS09 Dgr |
H330 H314 H373 ** H334 H317 H410 |
|
|
|
|
006-076-00-1 |
mancozeb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) complex with zinc salt |
- |
8018-01-7 |
Repr. 2 Skin Sens. 1 Aquatic Acute 1 |
H361d*** H317 H400 |
GHS08 GHS07 GHS09 Wng |
H361d*** H317 H400 |
|
M=10 |
|
|
006-077-00-7 |
maneb (ISO); manganese ethylenebis(dithiocarbamate) (polymeric) |
235-654-8 |
12427-38-2 |
Repr. 2 Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361d*** H332 H319 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361d*** H332 H319 H317 H410 |
|
M=10 |
|
|
006-078-00-2 |
zineb (ISO); zinc ethylenebis(dithiocarbamate) (polymeric) |
235-180-1 |
12122-67-7 |
STOT SE 3 Skin Sens. 1 |
H335 H317 |
GHS07 Wng |
H335 H317 |
|
|
|
|
006-079-00-8 |
disulfiram; tetraethylthiuramdisulfide |
202-607-8 |
97-77-8 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H302 H373 ** H317 H410 |
|
|
|
|
006-080-00-3 |
tetramethylthiuram monosulphide |
202-605-7 |
97-74-5 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Chronic 2 |
H302 H317 H411 |
GHS07 GHS09 Wng |
H302 H317 H411 |
|
|
|
|
006-081-00-9 |
zinc bis(dibutyldithiocarbamate) |
205-232-8 |
136-23-2 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H319 H335 H315 H317 H410 |
|
|
|
|
006-082-00-4 |
zinc bis(diethyldithiocarbamate) |
238-270-9 |
14324-55-1 |
Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H319 H335 H315 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H319 H335 H315 H317 H410 |
|
|
|
|
006-083-00-X |
butocarboxim (ISO); 3-(methylthio)-2-butanone O-[(methylamino)carbonyl]oxime |
252-139-3 |
34681-10-2 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H331 H311 H301 H319 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H226 H331 H311 H301 H319 H410 |
|
|
|
|
006-084-00-5 |
carbosulfan (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl [(dibutylamino)thio]methylcarbamate |
259-565-9 |
55285-14-8 |
Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H301 H317 H410 |
|
|
|
|
006-085-00-0 |
fenobucarb (ISO); 2-butylphenyl methylcarbamate |
223-188-8 |
3766-81-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
006-086-00-6 |
fenoxycarb (ISO); ethyl [2-(4-phenoxyphenoxy) ethyl]carbamate |
276-696-7 |
72490-01-8 |
Carc. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H400 H410 |
GHS08 GHS09 Wng |
H351 H410 |
|
M = 1 M = 10 000 |
605/2014 |
|
006-087-00-1 |
furathiocarb (ISO); 2,3-dihydro-2,2-dimethyl-7-benzofuryl 2,4-dimethyl-6-oxa-5-oxo-3-thia-2,4- diazadecanoate |
265-974-3 |
65907-30-4 |
Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H301 H373** H319 H315 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H301 H373** H319 H315 H317 H410 |
|
M = 100 |
758/2013 |
|
006-088-00-7 |
benfuracarb (ISO); ethyl N-[2,3-dihydro-2,2-dimethylbenzofuran-7-yloxycarbonyl(methyl)aminothio]-N-isopropyl- β-alaninate |
- |
82560-54-1 |
Repr. 2 Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H361f*** H331 H302 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H361f*** H331 H302 H410 |
|
|
|
|
006-090-00-8 |
2-(3-iodoprop-2-yn-1-yloxy)ethyl phenylcarbamate |
408-010-0 |
88558-41-2 |
Acute Tox. 4 * Eye Dam. 1 Aquatic Chronic 3 |
H332 H318 H412 |
GHS05 GHS07 Dgr |
H332 H318 H412 |
|
|
|
|
006-091-00-3 |
propineb (ISO); polymeric zinc propylenebis(dithiocarbamate) |
- |
9016-72-2 |
Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 |
H332 H373** H317 H400 |
GHS08 GHS07 GHS09 Wng |
H332 H373** H317 H400 |
|
|
|
|
006-092-00-9 |
tert-butyl (1S)-N-[1-((2S)-2-oxiranyl)-2-phenylethyl]carbamate |
425-420-5 |
98737-29-2 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
006-093-00-4 |
2,2'-dithio di(ethylammonium)-bis(dibenzyldithiocarbamate) |
427-180-7 |
- |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
006-094-00-X |
O-isobutyl-N-ethoxy carbonylthiocarbamate |
434-350-4 |
103122-66-3 |
Flam. Liq. 3 Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H226 H350 H340 H302 H373** H317 H411 |
GHS02 GHS08 GHS07 GHS09 Dgr |
H226 H350 H340 H302 H373** H317 H411 |
|
|
|
|
006-095-00-5 |
fosetyl-aluminium (ISO); aluminium triethyl triphosphonate |
254-320-2 |
39148-24-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
006-096-00-0 |
chlorpropham (ISO); isopropyl 3-chlorocarbanilate |
202-925-7 |
101-21-3 |
Carc. 2 STOT RE 2 * Aquatic Chronic 2 |
H351 H373** H411 |
GHS08 GHS09 Wng |
H351 H373** H411 |
|
|
|
|
006-097-00-6 |
1-phenyl-3-(p-toluenesulfonyl)urea |
424-620-1 |
13909-63-2 |
Acute Tox. 4 * STOT RE 2 * Aquatic Chronic 3 |
H302 H373** H412 |
GHS08 GHS07 Wng |
H302 H373** H412 |
|
|
|
|
006-098-00-1 |
tert-butyl (1R,5S)-3-azabicyclo [3.1.0]hex-6-ylcarbamate |
429-170-8 |
134575-17-0 |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H302 H373** H318 H317 |
GHS05 GHS08 GHS07 Dgr |
H302 H373** H318 H317 |
|
|
758/2013 |
|
006-099-00-7 |
N-(p-toluenesulfonyl)-N'-(3-(p-toluenesulfonyloxy)phenyl)urea; 3-({[(4-methylphenyl)sulfonyl]carbamoyl}amino)phenyl 4-methylbenzenesulfonate |
432-520-2 |
232938-43-1 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
006-101-00-6 |
reaction mass of: N,N''-(methylenedi-4,1-phenylene)bis[N'-phenylurea]; N-(4-[[4-[[(phenylamino)carbonyl]amino]phenylmethyl]phenyl]-N'-cyclohexylurea; N,N''-(methylenedi-4,1-phenylene)bis[N'-cyclohexylurea] |
423-070-8 |
- |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
006-102-00-1 |
O-hexyl-N-ethoxycarbonylthiocarbamate |
432-750-3 |
- |
Carc. 1B Muta. 1B Acute Tox. 4 * STOT RE 2 * Skin Sens. 1 Aquatic Chronic 2 |
H350 H340 H302 H373** H317 H411 |
GHS08 GHS07 GHS09 Dgr |
H350 H340 H302 H373** H317 H411 |
|
|
|
|
006-103-00-7 |
N,N''-(methylenedi-4,1-phenylene)bis[N'-octyl]urea |
445-760-8 |
- |
Eye Dam. 1 Resp. Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H334 H400 H410 |
GHS05 GHS08 GHS09 Dgr |
H318 H334 H410 |
|
M=100 |
|
|
007-001-00-5 |
ammonia, anhydrous |
231-635-3 |
7664-41-7 |
Flam. Gas 2 Press. Gas Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H221 H331 H314 H400 |
GHS04 GHS06 GHS05 GHS09 Dgr |
H221 H331 H314 H400 |
|
|
U
|
|
007-001-01-2 |
ammonia ....% |
215-647-6 |
1336-21-6 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
|
STOT SE 3; H335: C ≥ 5 % |
B
|
|
007-002-00-0 |
nitrogen dioxide; [1] dinitrogen tetraoxide [2] |
233-272-6 [1] 234-126-4 [2] |
10102-44-0 [1] 10544-72-6 [2] |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1B |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
|
* C ≥ 0,5 %: STOT SE 3; H335 |
5 |
|
007-003-00-6 |
chlormequat chloride (ISO); 2-chloroethyltrimethylammonium chloride |
213-666-4 |
999-81-5 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
007-004-00-1 |
nitric acid ... % |
231-714-2 |
7697-37-2 |
Ox. Liq. 3 Skin Corr. 1A |
H272 H314 |
GHS03 GHS05 Dgr |
H272 H314 |
|
Skin Corr. 1A; H314: C ≥ 20 % Skin Corr. 1B; H314: 5 % ≤ C < 20 % Ox. Liq. 3; H272: C ≥ 65 % |
B
|
|
007-006-00-2 |
ethyl nitrite |
203-722-6 |
109-95-5 |
Flam. Gas 1 Press. Gas Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H220 H332 H312 H302 |
GHS02 GHS04 GHS07 Dgr |
H220 H332 H312 H302 |
|
|
U
|
|
007-007-00-8 |
ethyl nitrate |
210-903-3 |
625-58-1 |
Unst. Expl. |
H200 |
GHS01 Dgr |
H200 |
|
|
758/2013 |
|
007-008-00-3 |
hydrazine |
206-114-9 |
302-01-2 |
Flam. Liq. 3 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H226 H350 H331 H311 H301 H314 H317 H400 H410 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H226 H350 H331 H311 H301 H314 H317 H410 |
|
Skin Corr. 1B; H314: C ≥ 10 % Skin Irrit. 2; H315: 3 % ≤ C < 10 % Eye Irrit. 2; H319: 3 % ≤ C < 10 % |
|
|
007-009-00-9 |
dicyclohexylammonium nitrite |
221-515-9 |
3129-91-7 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
* |
|
|
007-010-00-4 |
sodium nitrite |
231-555-9 |
7632-00-0 |
Ox. Sol. 3 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
|
* |
|
|
007-011-00-X |
potassium nitrite |
231-832-4 |
7758-09-0 |
Ox. Sol. 2 Acute Tox. 3 * Aquatic Acute 1 |
H272 H301 H400 |
GHS03 GHS06 GHS09 Dgr |
H272 H301 H400 |
|
* |
|
|
007-012-00-5 |
N,N-dimethylhydrazine |
200-316-0 |
57-14-7 |
Flam. Liq. 2 Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Skin Corr. 1B Aquatic Chronic 2 |
H225 H350 H331 H301 H314 H411 |
GHS02 GHS06 GHS08 GHS05 GHS09 Dgr |
H225 H350 H331 H301 H314 H411 |
|
|
|
|
007-013-00-0 |
1,2-dimethylhydrazine |
- |
540-73-8 |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H350 H331 H311 H301 H411 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H411 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
007-014-00-6 |
salts of hydrazine |
- |
- |
Carc. 1B Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H350 H331 H311 H301 H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H350 H331 H311 H301 H317 H410 |
|
|
A
|
|
007-015-00-1 |
O-ethylhydroxylamine |
402-030-3 |
624-86-2 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 1 Eye Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H225 H331 H311 H301 H372 ** H319 H317 H400 |
|
|
|
|
007-016-00-7 |
butyl nitrite |
208-862-1 |
544-16-1 |
Flam. Liq. 2 Acute Tox. 3 * Acute Tox. 3 * |
H225 H331 H301 |
GHS02 GHS06 Dgr |
H225 H331 H301 |
|
|
|
|
007-017-00-2 |
isobutyl nitrite |
208-819-7 |
542-56-3 |
Flam. Liq. 2 Carc. 1B Muta. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H350 H341 H332 H302 |
GHS02 GHS08 GHS07 Dgr |
H225 H350 H341 H332 H302 |
|
|
|
|
007-018-00-8 |
sec-butyl nitrite |
213-104-8 |
924-43-6 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
007-019-00-3 |
tert-butyl nitrite |
208-757-0 |
540-80-7 |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
007-020-00-9 |
pentyl nitrite; [1] ‘amyl nitrite’, mixed isomers [2] |
207-332-7 [1] 203-770-8 [2] |
463-04-7 [1] 110-46-3 [2] |
Flam. Liq. 2 Acute Tox. 4 * Acute Tox. 4 * |
H225 H332 H302 |
GHS02 GHS07 Dgr |
H225 H332 H302 |
|
|
|
|
007-021-00-4 |
hydrazobenzene; 1,2-diphenylhydrazine |
204-563-5 |
122-66-7 |
Carc. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H350 H302 H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H350 H302 H410 |
|
|
|
|
007-022-00-X |
hydrazine bis(3-carboxy-4-hydroxybenzensulfonate) |
405-030-1 |
- |
Carc. 1B Acute Tox. 4 * Skin Corr. 1B Skin Sens. 1 Aquatic Chronic 3 |
H350 H302 H314 H317 H412 |
GHS08 GHS05 GHS07 Dgr |
H350 H302 H314 H317 H412 |
|
|
|
|
007-023-00-5 |
sodium 3,5-bis(3-(2,4-di-tert-pentylphenoxy)propylcarbamoyl)benzenesulfonate |
405-510-0 |
- |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
007-024-00-0 |
2-(decylthio)ethylammonium chloride |
405-640-8 |
36362-09-1 |
STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H373 ** H315 H318 H400 H410 |
GHS08 GHS05 GHS09 Dgr |
H373 ** H315 H318 H410 |
|
|
|
|
007-025-00-6 |
(4-hydrazinophenyl)-N-methylmethanesulfonamide hydrochloride |
406-090-1 |
81880-96-8 |
Muta. 2 Acute Tox. 3 * STOT RE 1 Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H301 H372 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H301 H372 ** H317 H410 |
|
|
|
|
007-026-00-1 |
oxo-((2,2,6,6-tetramethylpiperidin-4-yl)amino)carbonylacetohydrazide |
413-230-5 |
122035-71-6 |
Eye Dam. 1 Skin Sens. 1 |
H318 H317 |
GHS05 GHS07 Dgr |
H318 H317 |
|
|
|
|
007-027-00-7 |
1,6-bis(3,3-bis((1-methylpentylidenimino)propyl)ureido)hexane |
420-190-2 |
771478-66-1 |
Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H312 H302 H373 ** H314 H317 H410 |
|
|
|
|
007-028-00-2 |
hydroxylammonium nitrate |
236-691-2 |
13465-08-2 |
Expl. 1.1 **** Carc. 2 Acute Tox. 3 * Acute Tox. 4 * STOT RE 2 * Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 Aquatic Acute 1 |
H201 H351 H311 H302 H373** H319 H315 H317 H400 |
GHS01 GHS06 GHS08 GHS09 Dgr |
H201 H351 H311 H302 H373** H319 H315 H317 H400 |
|
|
|
|
007-029-00-8 |
diethyldimethylammonium hydroxide |
419-400-5 |
95500-19-9 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
008-001-00-8 |
oxygen |
231-956-9 |
7782-44-7 |
Ox. Gas 1 Press. Gas |
H270 |
GHS03 GHS04 Dgr |
H270 |
|
|
U
|
|
008-003-00-9 |
hydrogen peroxide solution ... % |
231-765-0 |
7722-84-1 |
Ox. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H271 H332 H302 H314 |
GHS03 GHS05 GHS07 Dgr |
H271 H332 H302 H314 |
|
Ox. Liq. 1; H271: C ≥ 70 %**** Ox. Liq. 2; H272: 50 % ≤ C < 70 % **** * Skin Corr. 1A; H314: C ≥ 70 % Skin Corr. 1B; H314: 50 % ≤ C < 70 % Skin Irrit. 2; H315: 35 % ≤ C < 50 % Eye Dam. 1; H318: 8 % ≤ C < 50 % Eye Irrit. 2; H319: 5 % ≤ C < 8 % STOT SE 3; H335; C ≥ 35 % |
B
|
|
009-001-00-0 |
fluorine |
231-954-8 |
7782-41-4 |
Press. Gas Ox. Gas 1 Acute Tox. 2 * Skin Corr. 1A |
H270 H330 H314 |
GHS04 GHS03 GHS06 GHS05 Dgr |
H270 H330 H314 |
|
|
|
|
009-002-00-6 |
hydrogen fluoride |
231-634-8 |
7664-39-3 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1A |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
|
|
|
009-003-00-1 |
hydrofluoric acid ... % |
231-634-8 |
7664-39-3 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Skin Corr. 1A |
H330 H310 H300 H314 |
GHS06 GHS05 Dgr |
H330 H310 H300 H314 |
|
Skin Corr. 1A; H314: C ≥ 7 % Skin Corr. 1B; H314: 1 % ≤ C < 7 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
B
|
|
009-004-00-7 |
sodium fluoride |
231-667-8 |
7681-49-4 |
Acute Tox. 3 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H319 H315 |
GHS06 Dgr |
H301 H319 H315 |
EUH032
|
|
|
|
009-005-00-2 |
potassium fluoride |
232-151-5 |
7789-23-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
009-006-00-8 |
ammonium fluoride |
235-185-9 |
12125-01-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
009-007-00-3 |
sodium bifluoride; sodium hydrogen difluoride |
215-608-3 |
1333-83-1 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
009-008-00-9 |
potassium bifluoride; potassium hydrogen difluoride |
232-156-2 |
7789-29-9 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
009-009-00-4 |
ammonium bifluoride; ammonium hydrogen difluoride |
215-676-4 |
1341-49-7 |
Acute Tox. 3 * Skin Corr. 1B |
H301 H314 |
GHS06 GHS05 Dgr |
H301 H314 |
|
* Skin Corr. 1B; H314: C ≥ 1 % Skin Irrit. 2; H315: 0,1 % ≤ C < 1 % Eye Irrit. 2; H319: 0,1 % ≤ C < 1 % |
|
|
009-010-00-X |
fluoroboric acid ... % |
240-898-3 |
16872-11-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B
|
|
009-011-00-5 |
fluorosilicic acid ... % |
241-034-8 |
16961-83-4 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
B
|
|
009-012-00-0 |
alkali fluorosilicates(Na); [1] alkali fluorosilicates(K); [2] alkali fluorosilicates(NH4) [3] |
240-934-8 [1] 240-896-2 [2] 240-968-3 [3] |
16893-85-9 [1] 16871-90-2 [2] 16919-19-0 [3] |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
* |
A
|
|
009-013-00-6 |
fluorosilicates, with the exception of those specified elsewhere in this annex |
- |
- |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
* |
A
|
|
009-014-00-1 |
lead hexafluorosilicate |
247-278-1 |
25808-74-6 |
Repr. 1A Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H360Df H332 H302 H373 ** H400 H410 |
GHS08 GHS07 GHS09 Dgr |
H360Df H332 H302 H373 ** H410 |
|
|
1 |
|
009-015-00-7 |
sulphuryl difluoride |
220-281-5 |
2699-79-8 |
Press. Gas Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 |
H331 H373 ** H400 |
GHS04 GHS06 GHS08 GHS09 Dgr |
H331 H373 ** H400 |
|
|
U
|
|
009-016-00-2 |
trisodium hexafluoroaluminate [1] trisodium hexafluoroaluminate (cryolite) [2] |
237-410-6 [1] 239-148-8 [2] |
13775-53-6 [1] 15096-52-3 [2] |
STOT RE 1 Acute Tox. 4 Aquatic Chronic 2 |
H372 H332 H411 |
GHS07 GHS08 GHS09 Dgr |
H372 H332 H411 |
|
|
|
|
009-017-00-8 |
potassium mu-fluoro-bis(triethylaluminium) |
400-040-2 |
12091-08-6 |
Flam. Sol. 1 Water-react. 1 Skin Corr. 1A Acute Tox. 4 * |
H228 H270 H314 H332 |
GHS02 GHS05 GHS07 Dgr |
H228 H270 H314 H332 |
EUH014
|
|
T
|
|
009-018-00-3 |
magnesium hexafluorosilicate |
241-022-2 |
16949-65-8 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
* |
|
|
011-001-00-0 |
sodium |
231-132-9 |
7440-23-5 |
Water-react. 1 Skin Corr. 1B |
H260 H314 |
GHS02 GHS05 Dgr |
H260 H314 |
EUH014 |
|
|
|
011-002-00-6 |
sodium hydroxide; caustic soda |
215-185-5 |
1310-73-2 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 5 % Skin Corr. 1B; H314: 2 % ≤ C < 5 % Skin Irrit. 2; H315: 0,5 % ≤ C < 2 % Eye Irrit. 2; H319: 0,5 % ≤ C < 2 % |
|
|
011-003-00-1 |
sodium peroxide |
215-209-4 |
1313-60-6 |
Ox. Sol. 1 Skin Corr. 1A |
H271 H314 |
GHS03 GHS05 Dgr |
H271 H314 |
|
|
|
|
011-004-00-7 |
sodium azide |
247-852-1 |
26628-22-8 |
Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H400 H410 |
GHS06 GHS09 Dgr |
H300 H400 H410 |
EUH032
|
|
|
|
011-005-00-2 |
sodium carbonate |
207-838-8 |
497-19-8 |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
011-006-00-8 |
sodium cyanate |
213-030-6 |
917-61-3 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
011-007-00-3 |
propoxycarbazone-sodium |
- |
181274-15-7 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
M = 10 |
|
|
012-001-00-3 |
magnesium powder (pyrophoric) |
231-104-6 |
7439-95-4 |
Water-react. 1 Pyr. Sol. 1 |
H260 H250 |
GHS02 Dgr |
H260 H250 |
|
|
T
|
|
012-002-00-9 |
magnesium, powder or turnings |
231-104-6 |
- |
Flam. Sol. 1 Water-react. 2 Self-heat. 1 |
H228 H261 H252 |
GHS02 Dgr |
H228 H261 H252 |
|
|
T
|
|
012-003-00-4 |
magnesium alkyls |
- |
- |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014
|
|
A
|
|
012-004-00-X |
aluminium-magnesium-carbonate-hydroxide-perchlorate-hydrate |
422-150-1 |
- |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
013-001-00-6 |
aluminium powder (pyrophoric) |
231-072-3 |
7429-90-5 |
Water-react. 2 Pyr. Sol. 1 |
H261 H250 |
GHS02 Dgr |
H261 H250 |
|
|
T
|
|
013-002-00-1 |
aluminium powder (stabilised) |
231-072-3 |
7429-90-5 |
Water-react. 2 Flam. Sol. 1 |
H261 H228 |
GHS02 Dgr |
H261 H228 |
|
|
T
|
|
013-003-00-7 |
aluminium chloride, anhydrous |
231-208-1 |
7446-70-0 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
013-004-00-2 |
aluminium alkyls |
- |
- |
Pyr. Liq. 1 Water-react. 1 Skin Corr. 1B |
H250 H260 H314 |
GHS02 GHS05 Dgr |
H250 H260 H314 |
EUH014
|
|
A
|
|
013-005-00-8 |
diethyl(ethyldimethylsilanolato)aluminium |
401-160-8 |
55426-95-4 |
Water-react. 1 Pyr. Liq. 1 Skin Corr. 1A |
H260 H250 H314 |
GHS02 GHS05 Dgr |
H260 H250 H314 |
EUH014
|
|
|
|
013-006-00-3 |
(ethyl-3-oxobutanoato-O'1,O'3)(2-dimethylaminoethanolato)(1-methoxypropan-2-olato)aluminium(III), dimerised |
402-370-2 |
- |
Flam. Liq. 3 Eye Dam. 1 |
H226 H318 |
GHS02 GHS05 Dgr |
H226 H318 |
|
|
|
|
013-007-00-9 |
poly(oxo(2-butoxyethyl-3-oxobutanoato-O'1,O'3)aluminium) |
403-430-0 |
- |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
013-008-00-4 |
di-n-octylaluminium iodide |
408-190-0 |
7585-14-0 |
Pyr. Liq. 1 Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H250 H314 H400 H410 |
GHS02 GHS05 GHS09 Dgr |
H250 H314 H410 |
EUH014
|
|
|
|
013-009-00-X |
sodium((n-butyl)x(ethyl)y-1,5-dihydro)aluminate) x = 0,5, y = 1,5 |
418-720-2 |
- |
Flam. Sol. 1 Water-react. 1 Pyr. Sol. 1 Acute Tox. 4 * Skin Corr. 1A |
H228 H260 H250 H332 H314 |
GHS02 GHS05 GHS07 Dgr |
H228 H260 H250 H332 H314 |
EUH014
|
|
T
|
|
013-010-00-5 |
hydroxy aluminium bis(2,4,8,10-tetra-tert-butyl-6-hydroxy-12H-dibenzo[d,g][1.3.2]dioxaphosphocin-6-oxide) |
430-650-4 |
151841-65-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-001-00-9 |
trichlorosilane |
233-042-5 |
10025-78-2 |
Flam. Liq. 1 Pyr. Liq. 1 Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H224 H250 H332 H302 H314 |
GHS02 GHS05 GHS07 Dgr |
H224 H250 H332 H302 H314 |
EUH014 EUH029
|
* STOT SE 3; H335: C ≥ 1 % |
T
|
|
014-002-00-4 |
silicon tetrachloride |
233-054-0 |
10026-04-7 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
EUH014
|
|
|
|
014-003-00-X |
dimethyldichlorosilane |
200-901-0 |
75-78-5 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
|
|
|
|
014-004-00-5 |
trichloro(methyl)silane; methyltrichlorosilane |
200-902-6 |
75-79-6 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H225 H319 H335 H315 |
GHS02 GHS07 Dgr |
H225 H319 H335 H315 |
EUH014
|
Skin Irrit. 2; H315: C ≥ 1 % Eye Irrit. 2; H319: C ≥ 1 % STOT SE 3; H335: C ≥ 1 % |
|
|
014-005-00-0 |
tetraethyl silicate; ethyl silicate |
201-083-8 |
78-10-4 |
Flam. Liq. 3 Acute Tox. 4 * Eye Irrit. 2 STOT SE 3 |
H226 H332 H319 H335 |
GHS02 GHS07 Wng |
H226 H332 H319 H335 |
|
|
|
|
014-006-00-6 |
bis(4-fluorophenyl)-methyl-(1,2,4-triazol-4-ylmethyl)silane hydrochloride |
401-380-4 |
- |
Eye Irrit. 2 Aquatic Chronic 2 |
H319 H411 |
GHS07 GHS09 Wng |
H319 H411 |
|
|
|
|
014-007-00-1 |
triethoxyisobutylsilane |
402-810-3 |
17980-47-1 |
Skin Irrit. 2 |
H315 |
GHS07 Wng |
H315 |
|
|
|
|
014-008-00-7 |
(chloromethyl)bis(4-fluorophenyl)methylsilane |
401-200-4 |
85491-26-5 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-009-00-2 |
isobutylisopropyldimethoxysilane |
402-580-4 |
111439-76-0 |
Flam. Liq. 3 Acute Tox. 4 * Skin Irrit. 2 |
H226 H332 H315 |
GHS02 GHS07 Wng |
H226 H332 H315 |
|
|
|
|
014-010-00-8 |
disodium metasilicate |
229-912-9 |
6834-92-0 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
|
|
|
|
014-011-00-3 |
cyclohexyldimethoxymethylsilane |
402-140-1 |
17865-32-6 |
Skin Irrit. 2 Aquatic Chronic 2 |
H315 H411 |
GHS07 GHS09 Wng |
H315 H411 |
|
|
|
|
014-012-00-9 |
bis(3-(trimethoxysilyl)propyl)amine |
403-480-3 |
- |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
014-013-00-4 |
α-hydroxypoly(methyl-(3-(2,2,6,6-tetramethylpiperidin-4-yloxy)propyl)siloxane) |
404-920-7 |
- |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H312 H302 H314 H411 |
GHS05 GHS07 GHS09 Dgr |
H312 H302 H314 H411 |
|
|
|
|
014-014-00-X |
etacelasil (ISO); 6-(2-chloroethyl)-6-(2-methoxyethoxy)-2,5,7,10-tetraoxa-6-silaundecane |
253-704-7 |
37894-46-5 |
Repr. 1B Acute Tox. 4 * STOT RE 2 * |
H360D *** H302 H373 ** |
GHS08 GHS07 Dgr |
H360D *** H302 H373 ** |
|
|
|
|
014-015-00-5 |
α-trimethylsilanyl-ω-trimethylsiloxypoly[oxy(methyl-3-(2-(2-methoxypropoxy)propoxy)propylsilanediyl]-co-oxy(dimethylsilane)) |
406-420-4 |
69430-40-6 |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
014-016-00-0 |
reaction mass of: 1,3-dihex-5-en-1-yl-1,1,3,3-tetramethyldisiloxane; 1,3-dihex-n-en-1-yl-1,1,3,3-tetramethyldisiloxane |
406-490-6 |
- |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-017-00-6 |
flusilazole (ISO); bis(4-fluorophenyl)(methyl)(1H-1,2,4-triazol-1-ylmethyl)silane |
- |
85509-19-9 |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
|
|
|
|
014-018-00-1 |
octamethylcyclotetrasiloxane |
209-136-7 |
556-67-2 |
Repr. 2 Aquatic Chronic 4 |
H361f *** H413 |
GHS08 Wng |
H361f *** H413 |
|
|
|
|
014-019-00-7 |
reaction mass of: 4-[[bis-(4-fluorophenyl)methylsilyl]methyl]-4H-1,2,4-triazole; 1-[[bis-(4-fluorophenyl)methylsilyl]methyl]-1H-1,2,4-triazole |
403-250-2 |
- |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360D *** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360D *** H302 H411 |
|
|
|
|
014-020-00-2 |
bis(1,1-dimethyl-2-propynyloxy)dimethylsilane |
414-960-7 |
53863-99-3 |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
|
|
|
014-021-00-8 |
tris(isopropenyloxy)phenyl silane |
411-340-8 |
52301-18-5 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H400 H410 |
|
|
|
|
014-022-00-3 |
reaction product of: (2-hydroxy-4-(3-propenoxy)benzophenone and triethoxysilane) with (hydrolysis product of silica and methyltrimethoxysilane) |
401-530-9 |
- |
Flam. Sol. 1 STOT SE 1 Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H228 H370 ** H332 H312 H302 |
GHS02 GHS08 GHS07 Dgr |
H228 H370 ** H332 H312 H302 |
|
|
T
|
|
014-023-00-9 |
α, ω-dihydroxypoly(hex-5-en-1-ylmethylsiloxane)hoxysilane with (hydrolysis product of silica and methyltrimethoxysilane)iazole |
408-160-7 |
125613-45-8 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-024-00-4 |
1-((3-(3-chloro-4-fluorophenyl)propyl)dimethylsilanyl)-4-ethoxybenzene |
412-620-2 |
121626-74-2 |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-025-00-X |
4-[3-(diethoxymethylsilylpropoxy)-2,2,6,6-tetramethyl]piperidine |
411-400-3 |
102089-33-8 |
Acute Tox. 4 * STOT RE 2 * Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H302 H373 ** H315 H318 H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H315 H318 H412 |
|
|
|
|
014-026-00-5 |
dichloro-(3-(3-chloro-4-fluorophenyl)propyl)methylsilane |
407-180-3 |
770722-36-6 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
014-027-00-0 |
chloro(3-(3-chloro-4-fluorophenyl)propyl)dimethylsilane |
410-270-5 |
770722-46-8 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
014-028-00-6 |
α-[3-(1-oxoprop-2-eny)l-1-oxypropyl]dimethoxysilyloxy-ω-[3(1-oxoprop-2-enyl)-1-oxypropyl]dimethoxysilyl poly(dimethylsiloxane) |
415-290-8 |
193159-06-7 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
014-029-00-1 |
O,O'-(ethenylmethylsilylene)di[(4-methylpentan-2-one)oxime] |
421-870-1 |
156145-66-3 |
Repr. 2 Acute Tox. 4 * STOT RE 2 * |
H361f *** H302 H373 ** |
GHS08 GHS07 Wng |
H361f *** H302 H373 ** |
|
|
|
|
014-030-00-7 |
[(dimethylsilylene)bis((1,2,3,3a,7a-η)-1H-inden-1-ylidene)dimethyl]hafnium |
422-060-0 |
137390-08-0 |
Acute Tox. 2 * |
H300 |
GHS06 Dgr |
H300 |
|
|
|
|
014-031-00-2 |
bis(1-methylethyl)-dimethoxysilane |
421-540-7 |
18230-61-0 |
Flam. Liq. 3 Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H226 H315 H317 H412 |
GHS02 GHS07 Wng |
H226 H315 H317 H412 |
|
|
|
|
014-032-00-8 |
dicyclopentyldimethoxysilane |
404-370-8 |
126990-35-0 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H315 H318 H400 H410 |
GHS05 GHS09 Dgr |
H315 H318 H410 |
|
|
|
|
014-033-00-3 |
2-methyl-3-(trimethoxysilyl)propyl-2-propenoate hydrolysis product with silica |
419-030-4 |
125804-20-8 |
Flam. Liq. 2 Eye Irrit. 2 STOT SE 3 |
H225 H319 H336 |
GHS02 GHS07 Dgr |
H225 H319 H336 |
|
|
|
|
014-034-00-9 |
3-hexylheptamethyltrisiloxane |
428-700-5 |
1873-90-1 |
Acute Tox. 4 * Aquatic Chronic 4 |
H332 H413 |
GHS07 Wng |
H332 H413 |
|
|
|
|
014-035-00-4 |
2-(3,4-epoxycyclohexyl)ethyltriethoxy silane |
425-050-4 |
10217-34-2 |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
014-036-00-X |
(4-ethoxyphenyl)(3-(4-fluoro-3-phenoxyphenyl)propyl)dimethylsilane |
405-020-7 |
105024-66-6 |
Repr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H360F*** H400 H410 |
GHS08 GHS09 Dgr |
H360F*** H410 |
|
M=1000 |
|
|
014-037-00-5 |
2-butanone-O,O',O''-(phenylsilylidyne)trioxime |
433-360-6 |
34036-80-1 |
STOT RE 2 * Skin Sens. 1 Aquatic Chronic 3 |
H373** H317 H412 |
GHS08 GHS07 Wng |
H373** H317 H412 |
|
|
|
|
014-038-00-0 |
S-(3-(triethoxysilyl)propyl)octanethioate |
436-690-9 |
220727-26-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
014-039-00-6 |
(2,3-dimethylbut-2-yl)-trimethoxysilane |
439-360-2 |
142877-45-0 |
Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H315 H318 H412 |
GHS05 Dgr |
H315 H318 H412 |
|
|
|
|
014-041-00-7 |
N,N-bis(trimethylsilyl)aminopropylmethyldiethoxysilane |
445-890-5 |
201290-01-9 |
Acute Tox. 4 * Skin Sens. 1 |
H302 H317 |
GHS07 Wng |
H302 H317 |
|
|
|
|
014-042-00-2 |
reaction mass of: O,O',O'',O'''-silanetetrayl tetrakis(4-methyl-2-pentanone oxime) (3 stereoisomers) |
423-010-0 |
- |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
014-043-00-8 |
reaction product of amorphous silica (50-85 %), butyl (1-methylpropyl) magnesium (3-15 %), tetraethyl orthosilicate (5-15 %) and titanium tetrachloride (5-20 %) |
432-200-2 |
- |
STOT SE 3 Skin Irrit. 2 Eye Dam. 1 Aquatic Chronic 3 |
H335 H315 H318 H412 |
GHS05 GHS07 Dgr |
H335 H315 H318 H412 |
|
|
758/2013 |
|
014-044-00-3 |
3-[(4'-acetoxy-3'-methoxyphenyl) propyl]trimethoxysilane |
433-050-0 |
- |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
014-045-00-9 |
magnesium sodium fluoride silicate |
442-650-1 |
- |
STOT RE 2 * |
H373** |
GHS08 Wng |
H373** |
|
|
|
|
015-001-00-1 |
white phosphorus |
231-768-7 |
12185-10-3 |
Pyr. Sol. 1 Acute Tox. 2 * Acute Tox. 2 * Skin Corr. 1A Aquatic Acute 1 |
H250 H330 H300 H314 H400 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H250 H330 H300 H314 H400 |
|
|
|
|
015-002-00-7 |
red phosphorus |
231-768-7 |
7723-14-0 |
Flam. Sol. 1 Aquatic Chronic 3 |
H228 H412 |
GHS02 Dgr |
H228 H412 |
|
|
|
|
015-003-00-2 |
calcium phosphide; tricalcium diphosphide |
215-142-0 |
1305-99-3 |
|
H260 H300 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H400 |
EUH029
|
M=100 |
|
|
015-004-00-8 |
aluminium phosphide |
244-088-0 |
20859-73-8 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Aquatic Acute 1 |
H260 H300 H311 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M=100 |
944/2013 |
|
015-005-00-3 |
magnesium phosphide; trimagnesium diphosphide |
235-023-7 |
12057-74-8 |
Water-react. 1 Acute Tox. 2 Acute Tox. 3 Acute Tox. 1 Aquatic Acute 1
|
H260 H300 H311 H330 H400 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H311 H330 H400 |
EUH029 EUH032 |
M=100 |
944/2013 |
|
015-006-00-9 |
trizinc diphosphide; zinc phosphide |
215-244-5 |
1314-84-7 |
Water-react. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H260 H300 H400 H410 |
GHS02 GHS06 GHS09 Dgr |
H260 H300 H410 |
EUH029 EUH032
|
M=100 |
T
|
|
015-007-00-4 |
phosphorus trichloride |
231-749-3 |
7719-12-2 |
Acute Tox. 2 * Acute Tox. 2 * STOT RE 2 * Skin Corr. 1A |
H330 H300 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H300 H373 ** H314 |
EUH014 EUH029
|
|
|
|
015-008-00-X |
phosphorus pentachloride |
233-060-3 |
10026-13-8 |
Acute Tox. 2 * Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B |
H330 H302 H373 ** H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H302 H373 ** H314 |
EUH014 EUH029
|
|
|
|
015-009-00-5 |
phosphoryl trichloride |
233-046-7 |
10025-87-3 |
Acute Tox. 2 * STOT RE 1 Acute Tox. 4 * Skin Corr. 1A |
H330 H372 ** H302 H314 |
GHS06 GHS08 GHS05 Dgr |
H330 H372 ** H302 H314 |
EUH014 EUH029
|
|
|
|
015-010-00-0 |
phosphorus pentoxide |
215-236-1 |
1314-56-3 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
015-011-00-6 |
phosphoric acid ... %, orthophosphoric acid ... % |
231-633-2 |
7664-38-2 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
B
|
|
015-012-00-1 |
tetraphosphorus trisulphide; phosphorus sesquisulphid |
215-245-0 |
1314-85-8 |
Flam. Sol. 2 Water-react. 1 Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H302 H400 |
|
|
T
|
|
015-013-00-7 |
triethyl phosphate |
201-114-5 |
78-40-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
015-014-00-2 |
tributyl phosphate |
204-800-2 |
126-73-8 |
Carc. 2 Acute Tox. 4 * Skin Irrit. 2 |
H351 H302 H315 |
GHS08 GHS07 Wng |
H351 H302 H315 |
|
|
|
|
015-015-00-8 |
tricresyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-); tritolyl phosphate (o-o-o-, o-o-m-, o-o-p-, o-m-m-, o-m-p-, o-p-p-) |
201-103-5 |
78-30-8 |
STOT SE 1 Aquatic Chronic 2 |
H370 ** H411 |
GHS08 GHS09 Dgr |
H370 ** H411 |
|
STOT SE 1; H370: C ≥ 1 % STOT SE 2; H371: 0,2 % ≤ C < 1 % |
C
|
|
015-016-00-3 |
tricresyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-); tritolyl phosphate (m-m-m-, m-m-p-, m-p-p-, p-p-p-) |
201-105-6 |
78-32-0 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Chronic 2 |
H312 H302 H411 |
GHS07 GHS09 Wng |
H312 H302 H411 |
|
* |
C
|
|
015-019-00-X |
dichlorvos (ISO); 2,2-dichlorovinyl dimethyl phosphate |
200-547-7 |
62-73-7 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 |
H330 H311 H301 H317 H400 |
GHS06 GHS09 Dgr |
H330 H311 H301 H317 H400 |
|
M=1000 |
|
|
015-020-00-5 |
mevinphos (ISO); 2-methoxycarbonyl-1-methylvinyl dimethyl phosphate |
232-095-1 |
7786-34-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 10000 |
|
|
015-021-00-0 |
trichlorfon (ISO); dimethyl 2,2,2-trichloro-1-hydroxyethylphosphonate |
200-149-3 |
52-68-6 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H400 H410 |
|
M = 1000 |
|
|
015-022-00-6 |
phosphamidon (ISO); 2-chloro-2-diethylcarbamoyl-1-methylvinyl dimethyl phosphate |
236-116-5 |
13171-21-6 |
Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H300 H311 H410 |
|
|
|
|
015-023-00-1 |
pyrazoxon; diethyl 3-methylpyrazol-5-yl phosphate |
- |
108-34-9 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * |
H330 H310 H300 |
GHS06 Dgr |
H330 H310 H300 |
|
|
|
|
015-024-00-7 |
triamiphos (ISO); 5-amino-3-phenyl-1,2,4-triazol-1-yl-N,N,N',N'-tetramethylphosphonic diamide |
- |
1031-47-6 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-025-00-2 |
TEPP (ISO); tetraethyl pyrophosphate |
203-495-3 |
107-49-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
015-026-00-8 |
schradan (ISO); octamethylpyrophosphoramide |
205-801-0 |
152-16-9 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-027-00-3 |
sulfotep (ISO); O,O,O,O-tetraethyl dithiopyrophosphate |
222-995-2 |
3689-24-5 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
|
015-028-00-9 |
demeton-O (ISO); O,O-diethyl-O-2-ethylthioethyl phosphorothioate |
206-053-8 |
298-03-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
015-029-00-4 |
demeton-S (ISO); diethyl-S-2-ethylthioethyl phosphorothioate |
204-801-8 |
126-75-0 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-030-00-X |
demeton-O-methyl (ISO); O-2-ethylthioethyl O,O-dimethyl phosphorothioate |
212-758-1 |
867-27-6 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
015-031-00-5 |
demeton-S-methyl (ISO); S-2-ethylthioethyl dimethyl phosphorothioate |
213-052-6 |
919-86-8 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Chronic 2 |
H311 H301 H411 |
GHS06 GHS09 Dgr |
H311 H301 H411 |
|
|
|
|
015-032-00-0 |
prothoate (ISO); O,O-diethyl isopropylcarbamoylmethyl phosphorodithioate |
218-893-2 |
2275-18-5 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 3 |
H310 H300 H412 |
GHS06 Dgr |
H310 H300 H412 |
|
|
|
|
015-033-00-6 |
phorate (ISO); O,O-diethyl ethylthiomethyl phosphorodithioate |
206-052-2 |
298-02-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
|
015-034-00-1 |
parathion (ISO); O,O-diethyl O-4-nitrophenyl phosphorothioate |
200-271-7 |
56-38-2 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H372 ** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H300 H311 H372 ** H410 |
|
M = 100 |
|
|
015-035-00-7 |
parathion - methyl (ISO); O,O-dimethyl O-4-nitrophenyl phosphorothioate |
206-050-1 |
298-00-0 |
Flam. Liq. 3 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * STOT RE 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H226 H330 H300 H311 H373 ** H400 H410 |
GHS02 GHS06 GHS08 GHS09 Dgr |
H226 H330 H300 H311 H373 ** H410 |
|
M = 100 |
|
|
015-036-00-2 |
O-ethyl O-4-nitrophenyl phenylphosphonothioate; EPN |
218-276-8 |
2104-64-5 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
015-037-00-8 |
phenkapton (ISO); S-(2,5-dichlorophenylthiomethyl) O,O-diethyl phosphorodithioate |
218-892-7 |
2275-14-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
015-038-00-3 |
coumaphos (ISO); O-3-chloro-4-methylcoumarin-7-yl O,O-diethyl phosphorothioate |
200-285-3 |
56-72-4 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
015-039-00-9 |
azinphos-methyl (ISO); O,O-dimethyl-4-oxobenzotriazin-3-ylmethyl phosphorodithioate |
201-676-1 |
86-50-0 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H317 H410 |
|
|
|
|
015-040-00-4 |
diazinon (ISO); O,O-diethyl O-2-isopropyl-6-methylpyrimidin-4-yl phosphorothioate |
206-373-8 |
333-41-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
015-041-00-X |
malathion (ISO); 1,2-bis(ethoxycarbonyl)ethyl O,O-dimethyl phosphorodithioate; [containing ≤ 0.03 % isomalathion] |
204-497-7 |
121-75-5 |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
M=1000 |
|
|
015-042-00-5 |
chlorthion; O-(3-chloro-4-nitrophenyl) O,O-dimethyl phosphorothioate |
207-902-5 |
500-28-7 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 100 |
|
|
015-043-00-0 |
phosnichlor (ISO); O-4-chloro-3-nitrophenyl O,O-dimethyl phosphorothioate |
- |
5826-76-6 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * |
H332 H312 H302 |
GHS07 Wng |
H332 H312 H302 |
|
|
|
|
015-044-00-6 |
carbophenothion (ISO); 4-chlorophenylthiomethyl O,O-diethyl phosphorodithioate |
212-324-1 |
786-19-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
015-045-00-1 |
mecarbam (ISO); N-ethoxycarbonyl-N-methylcarbamoylmethyl O,O-diethyl phosphorodithioate |
219-993-9 |
2595-54-2 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H400 H410 |
|
|
|
|
015-046-00-7 |
oxydemeton-methyl; S-2-(ethylsulphinyl)ethyl O,O-dimethyl phosphorothioate |
206-110-7 |
301-12-2 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 |
H311 H301 H400 |
GHS06 GHS09 Dgr |
H311 H301 H400 |
|
|
|
|
015-047-00-2 |
ethion (ISO); O,O,O',O'-tetraethyl S,S'-methylenedi (phosphorodithioate); diethion |
209-242-3 |
563-12-2 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
M = 10000 |
|
|
015-048-00-8 |
fenthion (ISO); O,O-dimethyl-O-(4-methylthion-m-tolyl) phosphorothioate |
200-231-9 |
55-38-9 |
Muta. 2 Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 1 Aquatic Acute 1 Aquatic Chronic 1 |
H341 H331 H312 H302 H372** H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H331 H312 H302 H372** H410 |
|
M=100 |
|
|
015-049-00-3 |
endothion (ISO); S-5-methoxy-4-oxopyran-2-ylmethyl dimethyl phosphorothioate |
220-472-3 |
2778-04-3 |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
|
015-050-00-9 |
thiometon (ISO); S-2-ethylthioethyl O,O-dimethyl phosphorodithioate |
211-362-6 |
640-15-3 |
Acute Tox. 3 * Acute Tox. 4 * |
H301 H312 |
GHS06 Dgr |
H301 H312 |
|
|
|
|
015-051-00-4 |
dimethoate (ISO); O,O-dimethyl methylcarbamoylmethyl phosphorodithioate |
200-480-3 |
60-51-5 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
015-052-00-X |
fenchlorphos (ISO); O,O-dimethyl O-2,4,5-trichlorophenyl phosphorothioate |
206-082-6 |
299-84-3 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
015-053-00-5 |
menazon (ISO); S-[(4,6-diamino-1,3,5-triazin-2-yl)methyl] O,O-dimethyl phosphorodithioate |
201-123-4 |
78-57-9 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
015-054-00-0 |
fenitrothion (ISO); O,O-dimethyl O-4-nitro-m-tolyl phosphorothioate |
204-524-2 |
122-14-5 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
015-055-00-6 |
naled (ISO); 1,2-dibromo-2,2-dichloroethyl dimethyl phosphate |
206-098-3 |
300-76-5 |
Acute Tox. 4 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 |
H312 H302 H319 H315 H400 |
GHS07 GHS09 Wng |
H312 H302 H319 H315 H400 |
|
M = 1000 |
|
|
015-056-00-1 |
azinphos-ethyl (ISO); O,O-diethyl 4-oxobenzotriazin-3-ylmethyl phosphorodithioate |
220-147-6 |
2642-71-9 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M=100 |
|
|
015-057-00-7 |
formothion (ISO); N-formyl-N-methylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
219-818-6 |
2540-82-1 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
015-058-00-2 |
morphothion (ISO); O,O-dimethyl-S-(morpholinocarbonylmethyl) phosphorodithioate |
205-628-0 |
144-41-2 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H331 H311 H301 H410 |
|
|
|
|
015-059-00-8 |
vamidothion (ISO); O,O-dimethyl S-2-(1-methylcarbamoylethylthio) ethyl phosphorothioate |
218-894-8 |
2275-23-2 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
|
|
|
|
015-060-00-3 |
disulfoton (ISO); O,O-diethyl 2-ethylthioethyl phosphorodithioate |
206-054-3 |
298-04-4 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
015-061-00-9 |
dimefox (ISO); tetramethylphosphorodiamidic fluoride |
204-076-8 |
115-26-4 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-062-00-4 |
mipafox (ISO); N,N'- di-isopropylphosphorodiamidic fluoride |
206-742-3 |
371-86-8 |
STOT SE 1 |
H370 ** |
GHS08 Dgr |
H370 ** |
|
|
|
|
015-063-00-X |
dioxathion (ISO); 1,4-dioxan-2,3-diyl-O,O,O',O'-tetraethyl di(phosphorodithioate) |
201-107-7 |
78-34-2 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H330 H300 H311 H410 |
|
M = 1000 |
|
|
015-064-00-5 |
bromophos-ethyl (ISO); O-4-bromo-2,5-dichlorophenyl O,O-diethyl phosphorothioate |
225-399-0 |
4824-78-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
|
015-065-00-0 |
S-[2-(ethylsulphinyl)ethyl] O,O-dimethyl phosphorodithioate |
- |
2703-37-9 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H330 H310 H300 H411 |
GHS06 GHS09 Dgr |
H330 H310 H300 H411 |
|
|
|
|
015-066-00-6 |
omethoate (ISO); O,O-dimethyl S-methylcarbamoylmethyl phosphorothioate |
214-197-8 |
1113-02-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 |
H301 H312 H400 |
GHS06 GHS09 Dgr |
H301 H312 H400 |
|
|
|
|
015-067-00-1 |
phosalone (ISO); S-(6-chloro-2-oxobenzoxazolin-3-ylmethyl) O,O-diethyl phosphorodithioate |
218-996-2 |
2310-17-0 |
Acute Tox. 3 * Acute Tox. 4 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H332 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H301 H332 H312 H317 H410 |
|
M=1000 |
|
|
015-068-00-7 |
dichlofenthion (ISO); O-,4-dichlorophenyl O,O-diethyl phosphorothioate |
202-564-5 |
97-17-6 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H400 H410 |
|
|
|
|
015-069-00-2 |
methidathion (ISO); 2,3-dihydro-5-methoxy-2-oxo-1,3,4-thiadiazol-3-ylmethyl-O,O-dimethylphosphorodithioate |
213-449-4 |
950-37-8 |
Acute Tox. 2 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H312 H400 H410 |
GHS06 GHS09 Dgr |
H300 H312 H410 |
|
|
|
|
015-070-00-8 |
cyanthoate (ISO); S-(N-(1-cyano-1-methylethyl)carbamoylmethyl) O,O-diethyl phosphorothioate |
223-099-4 |
3734-95-0 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
015-071-00-3 |
chlorfenvinphos (ISO); 2-chloro-1-(2,4 dichlorophenyl) vinyl diethyl phosphate |
207-432-0 |
470-90-6 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
015-072-00-9 |
monocrotophos (ISO); dimethyl-1-methyl-2-(methylcarbamoyl)vinyl phosphate |
230-042-7 |
6923-22-4 |
Muta. 2 Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H341 H330 H300 H311 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H341 H330 H300 H311 H410 |
|
|
|
|
015-073-00-4 |
dicrotophos (ISO); (Z)-2-dimethylcarbamoyl-1-methylvinyl dimethyl phosphate |
205-494-3 |
141-66-2 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
015-074-00-X |
crufomate (ISO); 4-tert-butyl-2-chlorophenyl methyl methylphosphoramidate |
206-083-1 |
299-86-5 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
015-075-00-5 |
S-[2-(isopropylsulphinyl)ethyl] O,O-dimethyl phosphorothioate |
- |
2635-50-9 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
015-076-00-0 |
potasan; O,O-diethyl O-(4-methylcoumarin-7-yl) phosphorothioate |
- |
299-45-6 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H300 H410 |
|
M = 1000 |
|
|
015-077-00-6 |
2,2-dichlorovinyl 2-ethylsulphinylethyl methyl phosphate |
- |
7076-53-1 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 3 * |
H331 H311 H301 |
GHS06 Dgr |
H331 H311 H301 |
|
|
|
|
015-078-00-1 |
demeton-S-methylsulphon (ISO); S-2-ethylsulphonylethyl dimethyl phosphorothioate |
241-109-5 |
17040-19-6 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Chronic 2 |
H301 H312 H411 |
GHS06 GHS09 Dgr |
H301 H312 H411 |
|
|
|
|
015-079-00-7 |
acephate (ISO); O,S-dimethyl acetylphosphoramidothioate |
250-241-2 |
30560-19-1 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
015-080-00-2 |
amidithion (ISO); 2-methoxyethylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
- |
919-76-6 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
015-081-00-8 |
O,O,O',O'-tetrapropyl dithiopyrophosphate |
221-817-0 |
3244-90-4 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
015-082-00-3 |
azothoate (ISO); O-4-(4-chlorophenylazo)phenyl O,O-dimethyl phosphorothioate |
227-419-3 |
5834-96-8 |
Acute Tox. 4 * Acute Tox. 4 * |
H332 H302 |
GHS07 Wng |
H332 H302 |
|
|
|
|
015-083-00-9 |
bensulide (ISO); O,O-diisopropyl 2-phenylsulphonylaminoethyl phosphorodithioate |
212-010-4 |
741-58-2 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
015-084-00-4 |
chlorpyrifos (ISO); O,O-diethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
220-864-4 |
2921-88-2 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H400 H410 |
|
M = 10000 |
|
|
015-085-00-X |
chlorphonium chloride (ISO); tributyl (2,4-dichlorobenzyl) phosphonium chloride |
204-105-4 |
115-78-6 |
Acute Tox. 3 * Acute Tox. 4 * Eye Irrit. 2 Skin Irrit. 2 |
H301 H312 H319 H315 |
GHS06 Dgr |
H301 H312 H319 H315 |
|
|
|
|
015-086-00-5 |
coumithoate (ISO); O,O-diethyl O-,8,9,10-tetrahydro-6-oxo-benzo(c)chromen-3-yl phosphorothioate |
- |
572-48-5 |
Acute Tox. 3 * |
H301 |
GHS06 Dgr |
H301 |
|
|
|
|
015-087-00-0 |
cyanophos (ISO); O-4-cyanophenyl O,O-dimethyl phosphorothioate |
220-130-3 |
2636-26-2 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
|
|
|
015-088-00-6 |
dialifos (ISO); 2-chloro-1-phthalimidoethyl O,O-diethyl phosphorodithioate |
233-689-3 |
10311-84-9 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H400 H410 |
|
|
|
|
015-089-00-1 |
ethoate-methyl (ISO); ethylcarbamoylmethyl O,O-dimethyl phosphorodithioate |
204-121-1 |
116-01-8 |
Acute Tox. 4 * Acute Tox. 4 * |
H312 H302 |
GHS07 Wng |
H312 H302 |
|
|
|
|
015-090-00-7 |
fensulfothion (ISO); O,O-diethyl O-4-methylsulfinylphenyl phosphorothioate |
204-114-3 |
115-90-2 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
015-091-00-2 |
fonofos (ISO); O-ethyl phenyl ethylphosphonodithioate |
213-408-0 |
944-22-9 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
015-092-00-8 |
phosacetim (ISO); O,O-bis(4-chlorophenyl) N-acetimidoylphosphoramidothioate |
223-874-7 |
4104-14-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
|
|
|
015-093-00-3 |
leptophos (ISO); O-4-bromo-2,5-dichlorophenyl O-methyl phenylphosphorothioate |
244-472-8 |
21609-90-5 |
Acute Tox. 3 * STOT SE 1 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H370 ** H312 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H410 |
|
|
|
|
015-094-00-9 |
mephosfolan (ISO); diethyl 4-methyl-1,3-dithiolan-2-ylidenephosphoramidate |
213-447-3 |
950-10-7 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Chronic 2 |
H310 H300 H411 |
GHS06 GHS09 Dgr |
H310 H300 H411 |
|
|
|
|
015-095-00-4 |
methamidophos (ISO); O,S-dimethyl phosphoramidothioate |
233-606-0 |
10265-92-6 |
Acute Tox. 2 * Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 |
H330 H300 H311 H400 |
GHS06 GHS09 Dgr |
H330 H300 H311 H400 |
|
|
|
|
015-096-00-X |
oxydisulfoton (ISO); O, O-diethyl S-2-ethylsulphinylethyl phosphorodithioate |
219-679-1 |
2497-07-6 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 10 |
|
|
015-097-00-5 |
phenthoate (ISO); ethyl 2-(dimethoxyphosphinothioylthio)-2-phenylacetate |
219-997-0 |
2597-03-7 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
M = 100 |
|
|
015-098-00-0 |
trichloronate (ISO); O-ethyl O-2,4,5-trichlorophenyl ethylphosphonothioate |
206-326-1 |
327-98-0 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
|
|
|
015-099-00-6 |
pirimiphos-ethyl (ISO); O,O-diethyl O-2-diethylamino-6-methylpyrimidin-4-yl phosphorothioate |
245-704-0 |
23505-41-1 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
|
|
|
015-100-00-X |
phoxim (ISO); α-(diethoxyphosphinothioylimino) phenylacetonitrile |
238-887-3 |
14816-18-3 |
Repr. 2 Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H361f*** H302 H317 H400 H410 |
GHS08 GHS07 GHS09 Wng |
H361f*** H302 H317 H410 |
|
M=1000 |
|
|
015-101-00-5 |
phosmet (ISO); O,O-dimethyl phthalimidomethyl S-phosphorodithioate |
211-987-4 |
732-11-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H312 H302 H410 |
|
M = 100 |
|
|
015-102-00-0 |
tris(2-chloroethyl)phosphate |
204-118-5 |
115-96-8 |
Carc. 2 Repr. 1B Acute Tox. 4 * Aquatic Chronic 2 |
H351 H360F*** H302 H411 |
GHS08 GHS07 GHS09 Dgr |
H351 H360F*** H302 H411 |
|
|
|
|
015-103-00-6 |
phosphorus tribromide |
232-178-2 |
7789-60-8 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
015-104-00-1 |
diphosphorus pentasulphide; phosphorus pentasulphide |
215-242-4 |
1314-80-3 |
Flam. Sol. 1 Water-react. 1 Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H228 H260 H332 H302 H400 |
GHS02 GHS07 GHS09 Dgr |
H228 H260 H332 H302 H400 |
EUH029
|
|
T
|
|
015-105-00-7 |
triphenyl phosphite |
202-908-4 |
101-02-0 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H319 H315 H400 H410 |
GHS07 GHS09 Wng |
H319 H315 H410 |
|
Skin Irrit. 2; H315: C ≥ 5 % Eye Irrit. 2; H319: C ≥ 5 % |
|
|
015-106-00-2 |
hexamethylphosphoric triamide; hexamethylphosphoramide |
211-653-8 |
680-31-9 |
Carc. 1B Muta. 1B |
H350 H340 |
GHS08 Dgr |
H350 H340 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
015-107-00-8 |
ethoprophos (ISO); ethyl-S,S-dipropyl phosphorodithioate |
236-152-1 |
13194-48-4 |
Acute Tox. 2 * Acute Tox. 1 Acute Tox. 3 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H310 H301 H317 H400 H410 |
GHS06 GHS09 Dgr |
H330 H310 H301 H317 H410 |
|
|
|
|
015-108-00-3 |
bromophos (ISO); O-4-bromo-2,5-dichlorophenyl O,O-dimethyl phosphorothioate |
218-277-3 |
2104-96-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 100 |
|
|
015-109-00-9 |
crotoxyphos (ISO); 1-phenylethyl 3-(dimethoxyphosphinyloxy) isocrotonate |
231-720-5 |
7700-17-6 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 10 |
|
|
015-110-00-4 |
cyanofenphos (ISO); O-4-cyanophenyl O-ethyl phenylphosphonothioate |
- |
13067-93-1 |
Acute Tox. 3 * STOT SE 1 Acute Tox. 4 * Eye Irrit. 2 Aquatic Chronic 2 |
H301 H370 ** H312 H319 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H370 ** H312 H319 H411 |
|
|
|
|
015-111-00-X |
phosfolan (ISO); diethyl 1,3-dithiolan-2-ylidenephosphoramidate |
213-423-2 |
947-02-4 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-112-00-5 |
thionazin (ISO); O,O-diethyl O-pyrazin-2-yl phosphorothioate |
206-049-6 |
297-97-2 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-113-00-0 |
tolclofos-methyl (ISO); O-(2,6-dichloro-p-tolyl)-O,O-dimethyl thiophosphate |
260-515-3 |
57018-04-9 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
015-114-00-6 |
chlormephos (ISO); S-chloromethyl O,O-diethyl phosphorodithioate |
246-538-1 |
24934-91-6 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 10 |
758/2013 |
|
015-115-00-1 |
chlorthiophos (ISO); [isomeric reaction mass in which O- 2,5-dichlorophenyl-4-methylthiophenyl O,O-diethyl phosphorothioate predominates] |
244-663-6 |
21923-23-9 |
Acute Tox. 2 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H300 H311 H400 H410 |
GHS06 GHS09 Dgr |
H300 H311 H410 |
|
M = 1000 |
758/2013 |
|
015-116-00-7 |
demephion-O (ISO); O,O-dimethyl O-2-methylthioethyl phosphorothioate |
211-666-9 |
682-80-4 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
015-117-00-2 |
demephion-S (ISO); O,O-dimethyl S-2-methylthioethyl phosphorothioate |
219-971-9 |
2587-90-8 |
Acute Tox. 2 * Acute Tox. 3 * |
H300 H311 |
GHS06 Dgr |
H300 H311 |
|
|
|
|
015-118-00-8 |
demeton |
- |
8065-48-3 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 |
H310 H300 H400 |
GHS06 GHS09 Dgr |
H310 H300 H400 |
|
|
|
|
015-119-00-3 |
dimethyl 4-(methylthio)phenyl phosphate |
- |
3254-63-5 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
773-243-643 |
|
|
015-120-00-9 |
ditalimfos (ISO); O,O-diethyl phthalimidophosphonothioate |
225-875-8 |
5131-24-8 |
Skin Irrit. 2 Skin Sens. 1 |
H315 H317 |
GHS07 Wng |
H315 H317 |
|
|
|
|
015-121-00-4 |
edifenphos (ISO); O-ethyl S,S-diphenyl phosphorodithioate |
241-178-1 |
17109-49-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
|
|
|
|
015-122-00-X |
etrimfos (ISO); O-6-ethoxy-2-ethylpyrimidin-4-yl O,O-dimethylphosphorothioate |
253-855-9 |
38260-54-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
015-123-00-5 |
fenamiphos (ISO); ethyl-4-methylthio-m-tolyl isopropyl phosphoramidate |
244-848-1 |
22224-92-6 |
Acute Tox. 2 Acute Tox. 2 Acute Tox. 2 Eye Irrit. 2 Aquatic Acute 1 Aquatic Chronic 1 |
H300 H310 H330 H319 H400 H410 |
GHS06 GHS09 Dgr |
H300 H310 H330 H319 H410 |
|
M = 100 M = 100 |
944/2013 |
|
015-124-00-0 |
fosthietan (ISO); diethyl 1,3-dithietan-2-ylidenephosphoramidate |
244-437-7 |
21548-32-3 |
Acute Tox. 1 Acute Tox. 2 * |
H310 H300 |
GHS06 Dgr |
H310 H300 |
|
|
|
|
015-125-00-6 |
glyphosine (ISO); N,N-bis(phosphonomethyl)glycine |
219-468-4 |
2439-99-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
015-126-00-1 |
heptenophos (ISO); 7-chlorobicyclo(3.2.0)hepta-2,6-dien-6-yl dimethyl phosphate |
245-737-0 |
23560-59-0 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
M = 100 |
|
|
015-127-00-7 |
iprobenfos (ISO); S-benzyl diisopropyl phosphorothioate |
247-449-0 |
26087-47-8 |
Acute Tox. 4 * Aquatic Chronic 2 |
H302 H411 |
GHS07 GHS09 Wng |
H302 H411 |
|
|
|
|
015-128-00-2 |
IPSP; S-ethylsulphinylmethyl O,O-diisopropylphosphorodithioate |
- |
5827-05-4 |
Acute Tox. 1 Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H301 H400 H410 |
GHS06 GHS09 Dgr |
H310 H301 H410 |
|
M = 100 |
|
|
015-129-00-8 |
isofenphos (ISO); O-ethyl O-2-isopropoxycarbonylphenyl-isopropylphosphoramidothioate |
246-814-1 |
25311-71-1 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 100 |
|
|
015-130-00-3 |
isothioate (ISO); S-2-isopropylthioethyl O,O-dimethyl phosphorodithioate |
- |
36614-38-7 |
Acute Tox. 3 * Acute Tox. 3 * |
H311 H301 |
GHS06 Dgr |
H311 H301 |
|
|
|
|
015-131-00-9 |
isoxathion (ISO); O,O-diethyl O-5-phenylisoxazol-3-ylphosphorothioate |
242-624-8 |
18854-01-8 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
|
|
|
015-132-00-4 |
S-(chlorophenylthiomethyl) O,O-dimethylphosphorodithioate; methylcarbophenothione |
- |
953-17-3 |
Acute Tox. 3 * Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H311 H301 H400 H410 |
GHS06 GHS09 Dgr |
H311 H301 H410 |
|
M = 1000 |
|
|
015-133-00-X |
piperophos (ISO); S-2-methylpiperidinocarbonylmethyl-O,O-dipropyl phosphorodithioate |
- |
24151-93-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
M = 10 |
|
|
015-134-00-5 |
pirimiphos-methyl (ISO); O-(2-diethylamino-6-methylpyrimidin-4-yl) O,O-dimethyl phosphorothioate |
249-528-5 |
29232-93-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
015-135-00-0 |
profenofos (ISO); O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl phosphorothioate |
255-255-2 |
41198-08-7 |
Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H312 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H312 H302 H410 |
|
M = 1000 |
|
|
015-136-00-6 |
trans-isopropyl-3-[[(ethylamino)methoxyfosfinothioyl]oxy]crotonate; isopropyl 3-[[(ethylamino)methoxyphosphinothioyl]oxy]isocrotonate; propetamphos (ISO) |
250-517-2 |
31218-83-4 |
Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H400 H410 |
GHS06 GHS09 Dgr |
H301 H410 |
|
M = 100 |
|
|
015-137-00-1 |
pyrazophos (ISO); O,O-diethyl O-(6-ethoxycarbonyl-5-methylpyrazolo[2,3-a]pyrimidin-2-yl) phosphorothioate |
236-656-1 |
13457-18-6 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H332 H302 H400 H410 |
GHS07 GHS09 Wng |
H332 H302 H410 |
|
|
|
|
015-138-00-7 |
quinalphos (ISO); O,O-diethyl-O-quinoxalin-2-yl phosphorothioate |
237-031-6 |
13593-03-8 |
Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H301 H312 H410 |
|
M = 1000 |
|
|
015-139-00-2 |
terbufos (ISO); S-tert-butylthiomethyl O,O-diethylphosphorodithioate |
235-963-8 |
13071-79-9 |
Acute Tox. 1 Acute Tox. 2 * Aquatic Acute 1 Aquatic Chronic 1 |
H310 H300 H400 H410 |
GHS06 GHS09 Dgr |
H310 H300 H410 |
|
M = 1000 |
|
|
015-140-00-8 |
triazophos (ISO); O,O-diethyl-O-1-phenyl-1H-1,2,4-triazol-3-yl phosphorothioate |
245-986-5 |
24017-47-8 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H410 |
|
M=100 |
|
|
015-141-00-3 |
ethylenediammonium O,O-bis(octyl) phosphorodithioate, mixed isomers |
400-520-1 |
- |
Skin Corr. 1B Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H314 H302 H400 H410 |
GHS05 GHS07 GHS09 Dgr |
H314 H302 H410 |
|
|
|
|
015-142-00-9 |
butyl (dialkyloxy(dibutoxyphosphoryloxy))titanium (trialkyloxy)titanium phosphate |
401-100-0 |
- |
Flam. Liq. 2 Eye Irrit. 2 Aquatic Chronic 2 |
H225 H319 H411 |
GHS02 GHS07 GHS09 Dgr |
H225 H319 H411 |
|
|
T
|
|
015-143-00-4 |
reaction mass of 2-chloroethyl chloropropyl 2-chloroethylphosphonate, mixture reaction mass of isomers and 2-chloroethyl chloropropyl 2-chloropropylphosphonate, reaction mass of isomers |
401-740-0 |
- |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
015-144-00-X |
reaction mass of pentyl methylphosphinate and 2-methylbutyl methylphosphinate |
402-090-0 |
87025-52-3 |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
|
|
|
015-145-00-5 |
reaction mass of copper(I) O,O-diisopropyl phosphorodithioate and copper(I) O-isopropyl O-(4-methylpent-2-yl) phosphorodithioate and copper(I) O,O-bis(4-methylpent-2-yl) phosphorodithioate |
401-520-4 |
- |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
015-146-00-0 |
S-(tricyclo(5.2.1.02,6)deca-3-en-8(or 9)-yl O-(isopropyl or isobutyl or 2-ethylhexyl) O-(isopropyl or isobutyl or 2-ethylhexyl) phosphorodithioate |
401-850-9 |
- |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
015-147-00-6 |
reaction mass of C12-14-tert-alkylammonium diphenyl phosphorothioate and dinonyl sulphide (or disulphide) |
400-930-0 |
- |
Skin Irrit. 2 Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H315 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H315 H318 H317 H411 |
|
|
|
|
015-148-00-1 |
2-(diphosphonomethyl)succinic acid |
403-070-4 |
51395-42-7 |
Skin Corr. 1B Skin Sens. 1 |
H314 H317 |
GHS05 GHS07 Dgr |
H314 H317 |
|
|
|
|
015-149-00-7 |
reaction mass of: hexyldioctylphosphineoxide; dihexyloctylphosphineoxide; trioctylphosphineoxide |
403-470-9 |
- |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
015-150-00-2 |
(2-(1,3-dioxolan-2-yl)ethyl)triphenylphosphonium bromide |
404-940-6 |
86608-70-0 |
Acute Tox. 4 * Eye Dam. 1 STOT RE 2 * Aquatic Chronic 3 |
H302 H318 H373 ** H412 |
GHS08 GHS05 GHS07 Dgr |
H302 H318 H373 ** H412 |
|
|
|
|
015-151-00-8 |
tris(isopropyl/tert-butylphenyl) phosphate |
405-010-2 |
- |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
015-152-00-3 |
dioxabenzofos (ISO); 2-methoxy-4H-1,3,2-benzodioxaphosphorin 2-sulphide |
223-292-3 |
3811-49-2 |
Acute Tox. 3 * Acute Tox. 3 * STOT SE 1 Aquatic Chronic 2 |
H311 H301 H370 ** H411 |
GHS06 GHS08 GHS09 Dgr |
H311 H301 H370 ** H411 |
|
|
|
|
015-153-00-9 |
isazofos (ISO); O-(5-chloro-1-isopropyl-1,2,4-triazol-3-yl) O,O-diethyl phosphorothioate |
255-863-8 |
42509-80-8 |
Acute Tox. 2 * Acute Tox. 3 * Acute Tox. 3 * STOT RE 2 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H330 H311 H301 H373 ** H317 H400 H410 |
GHS06 GHS08 GHS09 Dgr |
H330 H311 H301 H373 ** H317 H410 |
|
|
|
|
015-154-00-4 |
ethephon; 2-chloroethylphosphonic acid |
240-718-3 |
16672-87-0 |
Acute Tox. 3 Acute Tox. 4 Acute Tox. 4 Skin Corr. 1C Aquatic Chronic 2 |
H311 H332 H302 H314 H411 |
GHS06 GHS05 GHS09 Dgr |
H311 H332 H302 H314 H411 |
EUH071 |
|
605/2014 |
|
015-155-00-X |
glufosinate ammonium (ISO); ammonium 2-amino-4-(hydroxymethylphosphinyl)butyrate |
278-636-5 |
77182-82-2 |
Repr. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * STOT RE 2 * |
H360Fd H332 H312 H302 H373** |
GHS08 GHS07 Dgr |
H360Fd H332 H312 H302 H373** |
|
|
|
|
015-156-00-5 |
methyl 3-[(dimethoxyphosphinothioyl)oxy]methacrylate; [1] methacrifos (ISO); methyl (E)-3-[(dimethoxyphosphinothioyl)oxy]methacrylate [2] |
250-366-9 [1] 250-366-9 [2] |
30864-28-9 [1] 62610-77-9 [2] |
Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H317 H400 H410 |
GHS07 GHS09 Wng |
H302 H317 H410 |
|
|
|
|
015-157-00-0 |
phosphonic acid; [1] phosphorous acid [2] |
237-066-7 [1] 233-663-1 [2] |
13598-36-2 [1] 10294-56-1 [2] |
Acute Tox. 4 * Skin Corr. 1A |
H302 H314 |
GHS05 GHS07 Dgr |
H302 H314 |
|
|
|
|
015-158-00-6 |
(η-cyclopentadienyl)(η-cumenyl)iron(1+)hexafluorophosphate(1-) |
402-340-9 |
32760-80-8 |
Aquatic Chronic 3 |
H412 |
|
H412 |
|
|
|
|
015-159-00-1 |
hydroxyphosphonoacetic acid |
405-710-8 |
23783-26-8 |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 |
H302 H373 ** H314 H317 |
GHS08 GHS05 GHS07 Dgr |
H302 H373 ** H314 H317 |
|
|
|
|
015-160-00-7 |
vanadyl pyrophosphate |
406-260-5 |
58834-75-6 |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
015-161-00-2 |
divanadyl pyrophosphate |
407-130-0 |
65232-89-5 |
Acute Tox. 4 * Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 2 |
H302 H318 H317 H411 |
GHS05 GHS07 GHS09 Dgr |
H302 H318 H317 H411 |
|
|
|
|
015-162-00-8 |
vanadium(IV) oxide hydrogen phosphate hemihydrate, lithium, zinc, molybdenum, iron and chlorine-doped |
407-350-7 |
- |
Acute Tox. 4 * STOT RE 2 * Eye Dam. 1 Aquatic Chronic 2 |
H332 H373 ** H318 H411 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H332 H373 ** H318 H411 |
|
|
|
|
015-163-00-3 |
bis(2,6-dimethoxybenzoyl)-2,4,4-trimethylpentylphosphinoxide |
412-010-6 |
145052-34-2 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
015-164-00-9 |
calcium P,P'-(1-hydroxyethylene)bis(hydrogen phosphonate)dihydrate |
400-480-5 |
36669-85-9 |
Aquatic Chronic 3 |
H412 |
|
H412 |
|
|
|
|
015-165-00-4 |
reaction mass of: thiobis(4,1-phenylene)-S,S,S',S'-tetraphenyldisulfonium bishexafluorophosphate; diphenyl(4-phenylthiophenyl)sulfonium hexafluorophosphate |
404-986-7 |
- |
Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H318 H400 H410 |
GHS05 GHS09 Dgr |
H318 H410 |
|
|
|
|
015-166-00-X |
3,9-bis(2,6-di-tert-butyl-4-methylphenoxy)-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
410-290-4 |
80693-00-1 |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
015-167-00-5 |
3-(hydroxyphenylphosphinyl)propanoic acid |
411-200-6 |
14657-64-8 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
015-168-00-0 |
fosthiazate (ISO); (RS)-S-sec-butyl-O-ethyl-2-oxo-1,3-thiazolidin-3-ylphosphonothioate |
- |
98886-44-3 |
Acute Tox. 3 * Acute Tox. 3 * Acute Tox. 4 * Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H331 H301 H312 H317 H400 H410 |
GHS06 GHS09 Dgr |
H331 H301 H312 H317 H410 |
EUH070
|
|
|
|
015-169-00-6 |
tributyltetradecylphosphonium tetrafluoroborate |
413-520-1 |
- |
Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H302 H373 ** H314 H317 H410 |
|
|
|
|
015-170-00-1 |
reaction mass of: di-(1-octane-N,N,N-trimethylammonium) octylphosphate; 1-octane-N,N,N-trimethylammonium di-octylphosphate; 1-octane-N,N,N-trimethylammonium octylphosphate |
407-490-9 |
- |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H312 H302 H314 |
GHS05 GHS07 Dgr |
H312 H302 H314 |
|
|
|
|
015-171-00-7 |
O,O,O-tris(2(or 4)-C9-10-isoalkylphenyl) phosphorothioate |
406-940-1 |
- |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
|
|
015-172-00-2 |
reaction mass of: bis(isotridecylammonium)mono(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate; isotridecylammonium bis(di-(4-methylpent-2-yloxy)thiophosphorothionylisopropyl)phosphate |
406-240-6 |
- |
Flam. Liq. 3 Skin Corr. 1B Aquatic Chronic 2 |
H226 H314 H411 |
GHS02 GHS05 GHS09 Dgr |
H226 H314 H411 |
|
|
|
|
015-173-00-8 |
methyl [2-(1,1-dimethylethyl)-6-methoxypyrimidin-4-yl]ethylphosphonothioate |
414-080-3 |
117291-73-3 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
015-174-00-3 |
1-chloro-N,N-diethyl-1,1-diphenyl-1-(phenylmethyl)phosphoramine |
411-370-1 |
82857-68-9 |
Acute Tox. 3 * Eye Dam. 1 Aquatic Chronic 2 |
H301 H318 H411 |
GHS06 GHS05 GHS09 Dgr |
H301 H318 H411 |
|
|
|
|
015-175-00-9 |
tert-butyl (triphenylphosphoranylidene) acetate |
412-880-7 |
35000-38-5 |
Acute Tox. 3 * STOT RE 2 * Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 2 |
H301 H373 ** H319 H317 H411 |
GHS06 GHS08 GHS09 Dgr |
H301 H373 ** H319 H317 H411 |
|
|
|
|
015-176-00-4 |
P,P,P',P'-tetrakis-(o-methoxyphenyl)propane-1,3-diphosphine |
413-430-2 |
116163-96-3 |
Aquatic Acute 1 Aquatic Chronic 1 |
H400 H410 |
GHS09 Wng |
H410 |
|
|
|
|
015-177-00-X |
((4-phenylbutyl)hydroxyphosphoryl)acetic acid |
412-170-7 |
83623-61-4 |
STOT RE 2 * Eye Dam. 1 Skin Sens. 1 |
H373 ** H318 H317 |
GHS08 GHS05 Dgr |
H373 ** H318 H317 |
|
|
|
|
015-178-00-5 |
(R)-α-phenylethylammonium (-)-(1R, 2S)-(1,2-epoxypropyl)phosphonate monohydrate |
418-570-8 |
25383-07-7 |
Repr. 2 Aquatic Chronic 2 |
H361f *** H411 |
GHS08 GHS09 Wng |
H361f *** H411 |
|
|
|
|
015-179-00-0 |
UVCB condensation product of: tetrakis-hydroxymethylphosphonium chloride, urea and distilled hydrogenated C16-18 tallow alkylamine |
422-720-8 |
166242-53-1 |
Carc. 2 Acute Tox. 4 * STOT RE 2 * Skin Corr. 1B Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H351 H302 H373 ** H314 H317 H400 H410 |
GHS08 GHS05 GHS07 GHS09 Dgr |
H351 H302 H373 ** H314 H317 H410 |
|
|
|
|
015-180-00-6 |
[R-(R*,S*)]-[[2-methyl-1-(1-oxopropoxy)propoxy]-(4-phenylbutyl)phosphinyl] acetic acid, (-)-cinchonidine (1:1) salt |
415-820-8 |
137590-32-0 |
Eye Dam. 1 Skin Sens. 1 Aquatic Chronic 3 |
H318 H317 H412 |
GHS05 GHS07 Dgr |
H318 H317 H412 |
|
|
|
|
015-181-00-1 |
phosphine |
232-260-8 |
7803-51-2 |
Flam. Gas 1 Press. Gas Acute Tox. 2 * Skin Corr. 1B Aquatic Acute 1 |
H220 H330 H314 H400 |
GHS02 GHS04 GHS06 GHS05 GHS09 Dgr |
H220 H330 H314 H400 |
|
|
U
|
|
015-182-00-7 |
tetrapropan-2-yl (dichloromethanediyl)bis(phosphonate) |
430-630-5 |
10596-22-2 |
Acute Tox. 4 * Eye Irrit. 2 Skin Sens. 1 |
H302 H319 H317 |
GHS07 Wng |
H302 H319 H317 |
|
|
758/2013
|
|
015-183-00-2 |
(1-hydroxydodecylidene)diphosphonic acid |
425-230-2 |
16610-63-2 |
Skin Corr. 1B Aquatic Acute 1 Aquatic Chronic 1 |
H314 H400 H410 |
GHS05 GHS09 Dgr |
H314 H410 |
|
|
|
|
015-184-00-8 |
Salts of glyphosate, with the exception of those specified elsewhere in this Annex |
- |
- |
Aquatic Chronic 2 |
H411 |
GHS09 |
H411 |
|
|
A
|
|
015-186-00-9 |
chlorpyrifos-methyl (ISO),; O, O-dimethyl O-3,5,6-trichloro-2-pyridyl phosphorothioate |
227-011-5 |
5598-13-0 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
M = 10000 |
|
|
015-187-00-4 |
reaction mass of: tetrasodium(((2-hydroxyethyl)imino)bis(methylene))bisphosphonate, N-oxide; trisodium ((tetrahydro-2-hydroxy-4H-1,4,2-oxazaphosphorin-4-yl)-methyl)phosphonate, N-oxide, P-oxide |
417-540-1 |
- |
Eye Dam. 1 Aquatic Chronic 2 |
H318 H411 |
GHS05 GHS09 Dgr |
H318 H411 |
|
|
|
|
015-189-00-5 |
phenyl bis(2,4,6-trimethylbenzoyl)-phosphine oxide |
423-340-5 |
162881-26-7 |
Skin Sens. 1 Aquatic Chronic 4 |
H317 H413 |
GHS07 Wng |
H317 H413 |
|
|
|
|
015-190-00-0 |
bis(2,4-dicumylphenyl) neopentyl diphosphite; 3,9-bis[2,4-bis(1-methyl-1-phenylethyl)phenoxy]-2,4,8,10-tetraoxa-3,9-diphosphaspiro[5.5]undecane |
421-920-2 |
154862-43-8 |
Aquatic Chronic 4 |
H413 |
|
H413 |
|
|
|
|
015-191-00-6 |
dodecyldiphenyl phosphate |
431-760-5 |
27460-02-2 |
Skin Irrit. 2 Aquatic Chronic 3 |
H315 H412 |
GHS07 Wng |
H315 H412 |
|
|
|
|
015-192-00-1 |
tetrakis(2,6-dimethylphenyl)-m-phenylene biphosphate |
432-770-2 |
139189-30-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
605/2014 |
|
015-193-00-7 |
triphenyl(phenylmethyl)phosphonium 1,1,2,2,3,3,4,4,4-nonafluoro-N-methyl-1-butanesulfonamide (1:1) |
442-960-7 |
332350-93-3 |
Acute Tox. 3 * Eye Dam. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H301 H318 H400 H410 |
GHS05 GHS06 GHS09 Dgr |
H301 H318 H410 |
|
|
|
|
015-194-00-2 |
tetrabutyl-phosphonium nonafluoro-butane-1-sulfonate |
444-440-5 |
220689-12-3 |
Acute Tox. 4 * Aquatic Chronic 3 |
H302 H412 |
GHS07 Wng |
H302 H412 |
|
|
|
|
015-195-00-8 |
reaction mass of: potassium o-toluenephosphonate; potassium m-toluenephosphonate; potassium p-toluenephosphonate |
433-860-4 |
- |
Eye Irrit. 2 Skin Sens. 1 Aquatic Chronic 3 |
H319 H317 H412 |
GHS07 Wng |
H319 H317 H412 |
|
|
|
|
015-196-00-3 |
reaction mass of: dimethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; diethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate; methyl ethyl (2-(hydroxymethylcarbamoyl)ethyl)phosphonate |
435-960-3 |
- |
Carc. 1B Muta. 1B Skin Sens. 1 |
H350 H340 H317 |
GHS08 GHS07 Dgr |
H350 H340 H317 |
|
|
|
|
015-197-00-9 |
bis(2,4,4-trimethylpentyl)dithiophosphonic acid |
420-160-9 |
107667-02-7 |
Flam. Liq. 3 Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Chronic 2 |
H226 H331 H302 H314 H411 |
GHS02 GHS06 GHS05 GHS09 Dgr |
H226 H331 H302 H314 H411 |
|
|
|
|
015-198-00-4 |
(4-phenylbutyl)phosphinic acid |
420-450-5 |
86552-32-1 |
Carc. 2 Eye Dam. 1 |
H351 H318 |
GHS05 GHS08 Dgr |
H351 H318 |
|
|
|
|
015-199-00-X |
tris[2-chloro-1-chloromethyl)ethyl] phosphate |
237-159-2 |
13674-87-8 |
Carc. 2 |
H351 |
GSH08 Wng |
H351
|
|
|
|
|
015-200-00-3 |
indium phosphide |
244-959-5 |
22398-80-7 |
Carc. 1B Repr. 2 STOT RE 1 |
H350 H361f H372 (plíce) |
GHS08 Dgr |
H350 H361f H372 (plíce |
|
STOT RE 1; H372: C ≥ 0,1 % Carc 1B; H350: C ≥ 0,01 % STOT RE 2; H373: 0,01 % ≤ C < 0,1 % |
|
|
015-201-00-9 |
trixylyl phosphate |
246-677-8 |
25155-23-1 |
Repr. 1B |
H360F |
GHS08 Dgr |
H360F
|
|
|
|
|
015-202-00-4 |
tris(nonylphenyl) phosphite |
247-759-6 |
26523-78-4 |
Skin Sens. 1 Aquatic Acute 1 Aquatic Chronic 1 |
H317 H400 H410 |
GHS07 GHS09 Wng |
H317 H410 |
|
|
|
|
015-203-00-X |
diphenyl(2,4,6- trimethylbenzoyl)phosphine oxide |
278-355-8 |
75980-60-8 |
Repr. 2 |
H361f (způsobuje atrofii varlat) |
GHS08 Wng |
H361f (způsobuje atrofii varlat) |
|
|
|
|
016-001-00-4 |
hydrogen sulphide |
231-977-3 |
7783-06-4 |
Flam. Gas 1 Press. Gas Acute Tox. 2 * Aquatic Acute 1 |
H220 H330 H400 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H330 H400 |
|
|
U
|
|
016-002-00-X |
barium sulphide |
244-214-4 |
21109-95-5 |
Acute Tox. 4 * Acute Tox. 4 * Aquatic Acute 1 |
H332 H302 H400 |
GHS07 GHS09 Wng |
H332 H302 H400 |
EUH031
|
|
|
|
016-003-00-5 |
barium polysulphides |
256-814-3 |
50864-67-0 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031
|
|
|
|
016-004-00-0 |
calcium sulphide |
243-873-5 |
20548-54-3 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031
|
|
|
|
016-005-00-6 |
calcium polysulphides |
215-709-2 |
1344-81-6 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 Aquatic Acute 1 |
H319 H335 H315 H400 |
GHS07 GHS09 Wng |
H319 H335 H315 H400 |
EUH031
|
|
|
|
016-006-00-1 |
dipotassium sulphide; potassium sulphide |
215-197-0 |
1312-73-8 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
|
|
|
016-007-00-7 |
potassium polysulphides |
253-390-1 |
37199-66-9 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
|
|
|
016-008-00-2 |
ammonium polysulphides |
232-989-1 |
9080-17-5 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH031 |
EUH031: C ≥ 1 % |
|
|
016-009-00-8 |
disodium sulfide; sodium sulfide |
215-211-5 |
1313-82-2 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1B Aquatic Acute 1 |
H311 H302 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H311 H302 H314 H400 |
|
|
|
|
016-010-00-3 |
sodium polysulphides |
215-686-9 |
1344-08-7 |
Acute Tox. 3 * Skin Corr. 1B Aquatic Acute 1 |
H301 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H314 H400 |
EUH031
|
|
|
|
016-011-00-9 |
sulphur dioxide |
231-195-2 |
7446-09-5 |
Press. Gas Acute Tox. 3 * Skin Corr. 1B |
H331 H314 |
GHS04 GHS06 GHS05 Dgr |
H331 H314 |
|
* |
U 5 |
|
016-012-00-4 |
disulphur dichloride; sulfur monochloride |
233-036-2 |
10025-67-9 |
Acute Tox. 3 * Acute Tox. 4 * Skin Corr. 1A Aquatic Acute 1 |
H301 H332 H314 H400 |
GHS06 GHS05 GHS09 Dgr |
H301 H332 H314 H400
|
EUH014 EUH029
|
STOT SE 3; H335: C ≥ 1 % |
|
|
016-013-00-X |
sulphur dichloride |
234-129-0 |
10545-99-0 |
Skin Corr. 1B STOT SE 3 Aquatic Acute 1 |
H314 H335 H400 |
GHS05 GHS07 GHS09 Dgr |
H314 H335 H400 |
EUH014
|
STOT SE 3; H335: C ≥ 5 % |
|
|
016-014-00-5 |
sulphur tetrachloride |
- |
13451-08-6 |
Skin Corr. 1B Aquatic Acute 1 |
H314 H400 |
GHS05 GHS09 Dgr |
H314 H400 |
EUH014 |
STOT SE 3; H335: C ≥ 5 % |
|
|
016-015-00-0 |
thionyl dichloride; thionyl chloride |
231-748-8 |
7719-09-7 |
Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1A |
H332 H302 H314 |
GHS05 GHS07 Dgr |
H332 H302 H314 |
EUH014 EUH029 |
STOT SE 3; H335: C ≥ 1 % |
|
|
016-016-00-6 |
sulphuryl chloride |
232-245-6 |
7791-25-5 |
Skin Corr. 1B STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
016-017-00-1 |
chlorosulphonic acid |
232-234-6 |
7790-94-5 |
Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
|
|
016-018-00-7 |
fluorosulphonic acid |
232-149-4 |
7789-21-1 |
Acute Tox. 4 * Skin Corr. 1A |
H332 H314 |
GHS05 GHS07 Dgr |
H332 H314 |
|
|
|
|
016-019-00-2 |
oleum ... % SO3 |
- |
- |
Skin Corr. 1A STOT SE 3 |
H314 H335 |
GHS05 GHS07 Dgr |
H314 H335 |
EUH014 |
|
B
|
|
016-020-00-8 |
sulphuric acid ... % |
231-639-5 |
7664-93-9 |
Skin Corr. 1A |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1A; H314: C ≥ 15 % Skin Irrit. 2; H315: 5 % ≤ C < 15 % Eye Irrit. 2; H319: 5 % ≤ C < 15 % |
B
|
|
016-021-00-3 |
methanethiol; methyl mercaptan |
200-822-1 |
74-93-1 |
Flam. Gas. 1 Press. Gas Acute Tox. 3 * Aquatic Acute 1 Aquatic Chronic 1 |
H220 H331 H400 H410 |
GHS02 GHS04 GHS06 GHS09 Dgr |
H220 H331 H410 |
|
|
U
|
|
016-022-00-9 |
ethanethiol; ethyl mercaptan |
200-837-3 |
75-08-1 |
Flam. Liq. 2 Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H225 H332 H400 H410 |
GHS02 GHS07 GHS09 Dgr |
H225 H332 H410 |
|
|
|
|
016-023-00-4 |
dimethyl sulphate |
201-058-1 |
77-78-1 |
Carc. 1B Muta. 2 Acute Tox. 2 * Acute Tox. 3 * Skin Corr. 1B Skin Sens. 1 |
H350 H341 H330 H301 H314 H317 |
GHS06 GHS08 GHS05 Dgr |
H350 H341 H330 H301 H314 H317 |
|
Carc. 1B; H350: C ≥ 0,01 % Muta. 2; H341: C ≥ 0,01 % STOT SE 3; H335: C ≥ 5 % |
|
|
016-024-00-X |
dimexano (ISO); bis(methoxythiocarbonyl) disulphide |
215-993-8 |
1468-37-7 |
Acute Tox. 4 * Aquatic Acute 1 Aquatic Chronic 1 |
H302 H400 H410 |
GHS07 GHS09 Wng |
H302 H410 |
|
|
|
|
016-025-00-5 |
disul (ISO); 2-(2,4-dichlorophenoxy)ethyl hydrogensulphate; 2,4-DES |
205-259-5 |
149-26-8 |
Acute Tox. 4 * Skin Irrit. 2 Eye Dam. 1 |
H302 H315 H318 |
GHS05 GHS07 Dgr |
H302 H315 H318 |
|
|
|
|
016-026-00-0 |
sulphamidic acid; sulphamic acid; sulfamic acid |
226-218-8 |
5329-14-6 |
Eye Irrit. 2 Skin Irrit. 2 Aquatic Chronic 3 |
H319 H315 H412 |
GHS07 Wng |
H319 H315 H412 |
|
|
|
|
016-027-00-6 |
diethyl sulphate |
200-589-6 |
64-67-5 |
Carc. 1B Muta. 1B Acute Tox. 4 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H340 H332 H312 H302 H314 |
GHS05 GHS08 GHS07 Dgr |
H350 H340 H332 H312 H302 H314 |
|
|
|
|
016-028-00-1 |
sodium dithionite; sodium hydrosulphite |
231-890-0 |
7775-14-6 |
Self-heat. 1 Acute Tox. 4 * |
H251 H302 |
GHS02 GHS07 Dgr |
H251 H302 |
EUH031 |
|
|
|
016-029-00-7 |
p-toluenesulphonic acid, containing more than 5 % H2SO4 |
- |
- |
Skin Corr. 1B |
H314 |
GHS05 Dgr |
H314 |
|
Skin Corr. 1B; H314: C ≥ 25 % Skin Irrit. 2; H315: 10 % ≤ C < 25 % Eye Irrit. 2; H319: 10 % ≤ C < 25 % |
|
|
016-030-00-2 |
p-toluenesulphonic acid (containing a maximum of 5 % H2SO4) |
203-180-0 |
104-15-4 |
Eye Irrit. 2 STOT SE 3 Skin Irrit. 2 |
H319 H335 H315 |
GHS07 Wng |
H319 H335 H315 |
|
STOT SE 3; H335: C ≥ 20 % |
|
|
016-031-00-8 |
tetrahydrothiophene-1,1-dioxide; sulpholane |
204-783-1 |
126-33-0 |
Acute Tox. 4 * |
H302 |
GHS07 Wng |
H302 |
|
|
|
|
016-032-00-3 |
1,3-propanesultone; 1,2-oxathiolane 2,2-dioxide |
214-317-9 |
1120-71-4 |
Carc. 1B Acute Tox. 4 * Acute Tox. 4 * |
H350 H312 H302 |
GHS08 GHS07 Dgr |
H350 H312 H302 |
|
Carc. 1B; H350: C ≥ 0,01 % |
|
|
016-033-00-9 |
dimethylsulfamoylchloride |
236-412-4 |
13360-57-1 |
Carc. 1B Acute Tox. 2 * Acute Tox. 4 * Acute Tox. 4 * Skin Corr. 1B |
H350 H330 H312 H302 H314 |
GHS06 GHS05 GHS08 Dgr |
H350 H330 H312 H302 H314 |
|
|
|
|
016-034-00-4 |
tetrasodium 3,3'-(piperazine-1,4-diylbis((6-chloro-1,3,5-triazine-2,4-diyl)imino(2-acetamido)-4,1-phenyleneazo))bis(naphthalene-1,5-disulphonate) |
400-010-9 |
81898-60-4 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-035-00-X |
pentasodium 5-anilino-3-(4-(4-(6-chloro-4-(3-sulphonatoanilino)-1,3,5-triazin-2-ylamino)-2,5-dimethylphenylazo)-2,5-disulphonatophenylazo)-4-hydroxynaphthalene-2,7-disulphonate |
400-120-7 |
- |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
016-036-00-5 |
tetrasodium 5-(4,6-dichloro-5-cyanopyrimidin-2-ylamino)-4-hydroxy-2,3-azodinaphthalene-1,2,5,7-disulphonate |
400-130-1 |
- |
Resp. Sens. 1 Aquatic Chronic 2 |
H334 H411 |
GHS08 GHS09 Dgr |
H334 H411 |
|
|
|
|
016-037-00-0 |
disodium 1-amino-4-(4-benzenesulphonamido-3-sulphonatoanilino)anthraquinone-2-sulphonate |
400-350-8 |
85153-93-1 |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
016-038-00-6 |
disodium 6-((4-chloro-6-(N-methyl)-2-toluidino)-1,3,5-triazin-2-ylamino)-1-hydroxy-2-(4-methoxy-2-sulphonatophenylazo)naphthalene-3-sulphonate |
400-380-1 |
86393-35-3 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-039-00-1 |
tetrasodium 2-(6-chloro-4-(4-(2,5-dimethyl-4-(2,5-disulphonatophenylazo)phenylazo)-3-ureidoanilino)-1,3,5-triazin-2-ylamino)benzene-1,4-disulphonate |
400-430-2 |
- |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-040-00-7 |
reaction mass of disodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(2,4-dihydroxyphenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and disodium 6-(2,4-diaminophenylazo)-3-(4-(4-(2,4-diaminophenylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate and trisodium 6-(2,4-dihydroxyphenylazo)-3-(4-(4-(7-(2,4-dihydroxyphenylazo)-1-hydroxy-3-sulphonato-2-naphthylazo)anilino)-3-sulphonatophenylazo)-4-hydroxynaphthalene-2-sulphonate |
400-570-4 |
- |
Eye Irrit. 2 |
H319 |
GHS07 Wng |
H319 |
|
|
|
|
016-041-00-2 |
calcium 2,5-dichloro-4-(4-((5-chloro-4-methyl-2-sulphonatophenyl)azo)-5-hydroxy-3-methylpyrazol-1-yl)benzenesulphonate |
400-710-4 |
- |
Acute Tox. 4 * |
H332 |
GHS07 Wng |
H332 |
|
773-243-643 |
|
|
016-042-00-8 |
tetrasodium 5-benzamido-3-(5-(4-fluoro-6-(1-sulphonato-2-naphthylamino)-1,3,5-triazin-2-ylamino)-2-sulphonatophenylazo)-4-hydroxynaphthalene-2,7- disulphonate |
400-790-0 |
85665-97-0 |
Eye Irrit. 2 Skin Irrit. 2 Skin Sens. 1 |
H319 H315 H317 |
GHS07 Wng |
H319 H315 H317 |
|
|
|
|
016-043-00-3 |
dilithium 6-acetamido-4-hydroxy-3-(4-((2-sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2-sulphonate |
401-010-1 |
- |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-044-00-9 |
disodium S,S-hexane-1,6-diyldi(thiosulphate) dihydrate |
401-320-7 |
- |
Skin Sens. 1 Aquatic Chronic 3 |
H317 H412 |
GHS07 Wng |
H317 H412 |
|
|
|
|
016-045-00-4 |
lithium sodium hydrogen 4-amino-6-(5-(5-chloro-2,6-difluoropyrimidin-4-ylamino)-2-sulphonatophenylazo)-5-hydroxy-3-(4-(2-(sulphonatooxy)ethylsulphonyl)phenylazo)naphthalene-2,7-disulphonate |
401-560-2 |
108624-00-6 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-046-00-X |
sodium hydrogensulphate |
231-665-7 |
7681-38-1 |
Eye Dam. 1 |
H318 |
GHS05 Dgr |
H318 |
|
|
|
|
016-047-00-5 |
hexasodium 7-(4-(4-(4-(2,5-disulphonatoanilino)-6-fluoro-1,3,5-triazin-2-ylamino)-2-methylphenylazo)-7-sulphonatonaphthylazo)naphthalene-1,3,5- trisulphonate |
401-650-1 |
85665-96-9 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-048-00-0 |
sodium 3,5-dichloro-2-(5-cyano-2,6-bis(3-hydroxypropylamino)-4-methylpyridin-3-ylazo)benzenesulphonate |
401-870-8 |
- |
Eye Dam. 1 Aquatic Chronic 3 |
H318 H412 |
GHS05 Dgr |
H318 H412 |
|
|
|
|
016-049-00-6 |
calcium octadecylxylenesulphonate |
402-040-8 |
- |
Skin Corr. 1B Aquatic Chronic 2 |
H314 H411 |
GHS05 GHS09 Dgr |
H314 H411 |
|
|
|
|
016-050-00-1 |
potassium sodium 5-(4-chloro-6-(N-(4-(4-chloro-6-(5-hydroxy-2,7-disulphonato-6-(2-sulphonatophenylazo)-4-naphthylamino)-1,3,5-triazin-2-ylamino) phenyl-N-methyl)amino)-1,3,5-triazin-2-ylamino)-4-hydroxy-3-(2-sulphonatophenylazo)naphthalene-2,7-disulphonat |
402-150-6 |
- |
Eye Irrit. 2 Skin Sens. 1 |
H319 H317 |
GHS07 Wng |
H319 H317 |
|
|
|
|
016-051-00-7 |
trisodium 7-(4-(6-fluoro-4-(2-(2-vinylsulphonylethoxy)ethylamino)-1,3,5-triazin-2-ylamino)-2-ureidophenylazo)naphthalene-1,3,6- trisulphonate |
402-170-5 |
106359-91-5 |
Skin Sens. 1 |
H317 |
GHS07 Wng |
H317 |
|
|
|
|
016-052-00-2 |
benzyltributylammonium 4-hydroxynaphthalene-1-sulphonate |
402-240-5 |
102561-46-6 |
Acute Tox. 4 * Aquatic Chronic 2 |
H332 H411 |
GHS07 GHS09 Wng |
H332 H411 |
|
|
|
|
016-053-00-8 |
(C16 or C18-n-alkyl)(C16 or C18-n-alkyl)ammonium 2-((C16 or C18-n-alkyl)(C16 or C18-n-alkyl)carbamoyl)benzenesulphonate |
402-460-1 |
- |
Skin Irrit. 2 Skin Sens. 1 Aquatic Chronic 4 |
H315 H317 H413 |
GHS07 Wng |
H315 H317 H413 |
|
|
|
Seznam harmonizovaných klasifikací chemických látek
Seznam harmonizovaných klasifikací chemických látek uvedený v části 3 přílohy VI nařízení CLP
| Kód článku | CLP |
|---|---|
| Obsah |
|